[1-(3,4-Dimethoxyphenyl)-3-(hydroxymethyl)-6,7,8-trimethoxy-1,2-dihydronaphthalen-2-yl]methanol
| Internal ID | 7cebcedd-7232-4b44-a704-ef5a8f08bbbd |
| Taxonomy | Lignans, neolignans and related compounds > Aryltetralin lignans |
| IUPAC Name | [1-(3,4-dimethoxyphenyl)-3-(hydroxymethyl)-6,7,8-trimethoxy-1,2-dihydronaphthalen-2-yl]methanol |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C2C(C(=CC3=CC(=C(C(=C23)OC)OC)OC)CO)CO)OC |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)C2C(C(=CC3=CC(=C(C(=C23)OC)OC)OC)CO)CO)OC |
| InChI | InChI=1S/C23H28O7/c1-26-17-7-6-13(9-18(17)27-2)20-16(12-25)15(11-24)8-14-10-19(28-3)22(29-4)23(30-5)21(14)20/h6-10,16,20,24-25H,11-12H2,1-5H3 |
| InChI Key | JYHDDVRSLXGQAB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.18350323 g/mol |
| Topological Polar Surface Area (TPSA) | 86.60 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
![2D Structure of [1-(3,4-Dimethoxyphenyl)-3-(hydroxymethyl)-6,7,8-trimethoxy-1,2-dihydronaphthalen-2-yl]methanol](https://plantaedb.com/storage/docs/compounds/2023/11/1-34-dimethoxyphenyl-3-hydroxymethyl-678-trimethoxy-12-dihydronaphthalen-2-ylmethanol.jpg "2D Structure of [1-(3,4-Dimethoxyphenyl)-3-(hydroxymethyl)-6,7,8-trimethoxy-1,2-dihydronaphthalen-2-yl]methanol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.42% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.96% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.92% | 91.11% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.62% | 89.62% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.69% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.10% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.97% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.17% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.80% | 99.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.67% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.48% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 80.66% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Magnolia biondii |
| PubChem | 85267988 |
| LOTUS | LTS0046457 |
| wikiData | Q105137002 |