1-(3,4-Dimethoxyphenyl)-3-(2,4,6-trimethoxyphenyl)propan-2-ol
Internal ID | f0ac4016-602b-4d89-bbd4-0c271705a931 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids |
IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(2,4,6-trimethoxyphenyl)propan-2-ol |
SMILES (Canonical) | COC1=C(C=C(C=C1)CC(CC2=C(C=C(C=C2OC)OC)OC)O)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)CC(CC2=C(C=C(C=C2OC)OC)OC)O)OC |
InChI | InChI=1S/C20H26O6/c1-22-15-11-18(24-3)16(19(12-15)25-4)10-14(21)8-13-6-7-17(23-2)20(9-13)26-5/h6-7,9,11-12,14,21H,8,10H2,1-5H3 |
InChI Key | UYGPHIAWXUWOFJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H26O6 |
Molecular Weight | 362.40 g/mol |
Exact Mass | 362.17293854 g/mol |
Topological Polar Surface Area (TPSA) | 66.40 Ų |
XlogP | 3.40 |
There are no found synonyms. |
![2D Structure of 1-(3,4-Dimethoxyphenyl)-3-(2,4,6-trimethoxyphenyl)propan-2-ol 2D Structure of 1-(3,4-Dimethoxyphenyl)-3-(2,4,6-trimethoxyphenyl)propan-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/1-34-dimethoxyphenyl-3-246-trimethoxyphenylpropan-2-ol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.55% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.29% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.55% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.84% | 99.17% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 90.12% | 90.20% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.10% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 86.72% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.63% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.66% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.42% | 95.50% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.78% | 90.24% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.73% | 92.68% |
CHEMBL240 | Q12809 | HERG | 83.37% | 89.76% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.87% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.68% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.05% | 94.45% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.15% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Litsea hypophaea |
PubChem | 21722174 |
LOTUS | LTS0023002 |
wikiData | Q105281409 |