1-(3-Hydroxy-2,4-dimethyldodec-4-enoyl)pyrrolidine-2-carboxylic acid
| Internal ID | 9a74c9ce-84a3-4bdc-998e-e363bb61064a |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > N-acyl-alpha amino acids |
| IUPAC Name | 1-(3-hydroxy-2,4-dimethyldodec-4-enoyl)pyrrolidine-2-carboxylic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C19H33NO4/c1-4-5-6-7-8-9-11-14(2)17(21)15(3)18(22)20-13-10-12-16(20)19(23)24/h11,15-17,21H,4-10,12-13H2,1-3H3,(H,23,24) |
| InChI Key | JFFANXXIOVCBBG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.24095853 g/mol |
| Topological Polar Surface Area (TPSA) | 77.80 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.96% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.44% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.85% | 96.09% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 94.98% | 92.86% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.23% | 89.63% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 93.37% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.26% | 96.47% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.47% | 93.56% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 91.41% | 98.33% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 90.12% | 92.12% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.82% | 100.00% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 89.80% | 97.50% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.33% | 97.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.32% | 99.17% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 88.40% | 99.18% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 88.34% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.93% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.69% | 94.45% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 86.80% | 94.66% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.61% | 91.19% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 86.18% | 91.81% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.53% | 90.71% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 84.31% | 92.86% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 84.29% | 97.64% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.28% | 90.24% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.15% | 93.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.55% | 94.33% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.52% | 97.50% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.51% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.22% | 95.89% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 82.01% | 96.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 81.92% | 98.10% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.91% | 95.50% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 81.52% | 98.24% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.76% | 97.09% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.66% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73836736 |
| LOTUS | LTS0075978 |
| wikiData | Q104169462 |