1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3,5-dimethylpyrimidine-2,4-dione
| Internal ID | a6dddfd5-854d-490d-bd90-0016a0ab6bd4 |
| Taxonomy | Nucleosides, nucleotides, and analogues > Pyrimidine nucleosides > Pyrimidine 2-deoxyribonucleosides |
| IUPAC Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3,5-dimethylpyrimidine-2,4-dione |
| SMILES (Canonical) | CC1=CN(C(=O)N(C1=O)C)C2CC(C(O2)CO)O |
| SMILES (Isomeric) | CC1=CN(C(=O)N(C1=O)C)[C@H]2CC([C@H](O2)CO)O |
| InChI | InChI=1S/C11H16N2O5/c1-6-4-13(11(17)12(2)10(6)16)9-3-7(15)8(5-14)18-9/h4,7-9,14-15H,3,5H2,1-2H3/t7?,8-,9-/m1/s1 |
| InChI Key | JCVDICFLPGDHAT-CFCGPWAMSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10592162 g/mol |
| Topological Polar Surface Area (TPSA) | 90.30 Ų |
| XlogP | -1.00 |
| There are no found synonyms. |
![2D Structure of 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3,5-dimethylpyrimidine-2,4-dione](https://plantaedb.com/storage/docs/compounds/2023/11/1-2r5r-4-hydroxy-5-hydroxymethyloxolan-2-yl-35-dimethylpyrimidine-24-dione.jpg "2D Structure of 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3,5-dimethylpyrimidine-2,4-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.65% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.32% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.74% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.46% | 98.95% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 91.91% | 98.46% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.73% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.92% | 89.00% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 84.80% | 94.45% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 84.00% | 96.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.87% | 95.89% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 81.31% | 95.93% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.26% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6419407 |
| LOTUS | LTS0125038 |
| wikiData | Q105125150 |