1-(2,4-Dihydroxyphenyl)-2-(2-hydroxy-4-methoxyphenyl)ethane-1,2-dione
| Internal ID | cb737132-a778-44b0-b7d9-02ee46bab2a6 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-2-(2-hydroxy-4-methoxyphenyl)ethane-1,2-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H12O6/c1-21-9-3-5-11(13(18)7-9)15(20)14(19)10-4-2-8(16)6-12(10)17/h2-7,16-18H,1H3 |
| InChI Key | KTPAXKNOIBKDFX-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | 2.90 |
| DTXSID50759112 |
| 2,4,2'-trihydroxy-4'-methoxybenzil |
| 1-(2,4-Dihydroxyphenyl)-2-(2-hydroxy-4-methoxyphenyl)ethane-1,2-dione |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.50% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.57% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.72% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.83% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.11% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.52% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.86% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.08% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.52% | 94.00% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 83.64% | 96.12% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.50% | 86.33% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.29% | 91.07% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.02% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zollernia paraensis |
| PubChem | 71330404 |
| LOTUS | LTS0079502 |
| wikiData | Q82712963 |