1-[2,4-Dihydroxy-6-[(1 e)-2-(4-hydroxyphenyl)ethenyl]phenyl]-2-methyl-1-propanone
| Internal ID | 87fd4c07-ed92-4097-b1cf-2792e40a716e |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 1-[2,4-dihydroxy-6-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]-2-methylpropan-1-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H18O4/c1-11(2)18(22)17-13(9-15(20)10-16(17)21)6-3-12-4-7-14(19)8-5-12/h3-11,19-21H,1-2H3/b6-3+ |
| InChI Key | VFXYKTYCSDCSTE-ZZXKWVIFSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 77.80 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
![2D Structure of 1-[2,4-Dihydroxy-6-[(1 e)-2-(4-hydroxyphenyl)ethenyl]phenyl]-2-methyl-1-propanone](https://plantaedb.com/storage/docs/compounds/2023/11/1-24-dihydroxy-6-1-e-2-4-hydroxyphenylethenylphenyl-2-methyl-1-propanone.jpg "2D Structure of 1-[2,4-Dihydroxy-6-[(1 e)-2-(4-hydroxyphenyl)ethenyl]phenyl]-2-methyl-1-propanone")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.58% | 91.11% |
| CHEMBL3194 | P02766 | Transthyretin | 95.87% | 90.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.92% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.69% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.51% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.56% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.23% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.88% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.25% | 96.09% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.64% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.34% | 90.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 85.86% | 97.23% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.11% | 96.12% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.77% | 99.15% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.61% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.61% | 86.33% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.77% | 93.10% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.52% | 99.17% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 81.30% | 98.35% |
| CHEMBL1907588 | P02708 | Acetylcholine receptor; alpha1/beta1/delta/gamma | 81.01% | 98.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ekebergia benguelensis |
| PubChem | 10494301 |
| LOTUS | LTS0085345 |
| wikiData | Q105285642 |