1-[(2-Hydroxyphenyl)methyl]-2-pyridin-3-ylpiperidin-2-ol
| Internal ID | d62d859f-b114-4cb7-bc6b-60e4f5567d3e |
| Taxonomy | Organoheterocyclic compounds > Piperidines > Benzylpiperidines > N-benzylpiperidines |
| IUPAC Name | 1-[(2-hydroxyphenyl)methyl]-2-pyridin-3-ylpiperidin-2-ol |
| SMILES (Canonical) | C1CCN(C(C1)(C2=CN=CC=C2)O)CC3=CC=CC=C3O |
| SMILES (Isomeric) | C1CCN(C(C1)(C2=CN=CC=C2)O)CC3=CC=CC=C3O |
| InChI | InChI=1S/C17H20N2O2/c20-16-8-2-1-6-14(16)13-19-11-4-3-9-17(19,21)15-7-5-10-18-12-15/h1-2,5-8,10,12,20-21H,3-4,9,11,13H2 |
| InChI Key | BBKITNAKQHKIJO-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.152477885 g/mol |
| Topological Polar Surface Area (TPSA) | 56.60 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
![2D Structure of 1-[(2-Hydroxyphenyl)methyl]-2-pyridin-3-ylpiperidin-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/1-2-hydroxyphenylmethyl-2-pyridin-3-ylpiperidin-2-ol.jpg "2D Structure of 1-[(2-Hydroxyphenyl)methyl]-2-pyridin-3-ylpiperidin-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.78% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.66% | 96.09% |
| CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 93.66% | 97.98% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.68% | 98.95% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 92.30% | 93.10% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.71% | 90.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.72% | 93.40% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 87.37% | 96.25% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.25% | 94.62% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 84.14% | 91.38% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.63% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.66% | 94.45% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.51% | 94.08% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 82.19% | 93.81% |
| CHEMBL1741221 | Q9Y4P1 | Cysteine protease ATG4B | 81.63% | 87.50% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 80.79% | 91.73% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.61% | 90.24% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 80.06% | 91.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alangium chinense |
| PubChem | 73356513 |
| LOTUS | LTS0265722 |
| wikiData | Q104922810 |