1-[2-(3,7-Dimethyl-2,6-octadien-1-yl)-4-hydroxy-6-methoxyphenyl]ethanone
Internal ID | 596ade30-0018-4f8c-8e9e-a707c2ca1946 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Phenylketones > Alkyl-phenylketones |
IUPAC Name | 1-[2-(3,7-dimethylocta-2,6-dienyl)-4-hydroxy-6-methoxyphenyl]ethanone |
SMILES (Canonical) | CC(=CCCC(=CCC1=C(C(=CC(=C1)O)OC)C(=O)C)C)C |
SMILES (Isomeric) | CC(=CCCC(=CCC1=C(C(=CC(=C1)O)OC)C(=O)C)C)C |
InChI | InChI=1S/C19H26O3/c1-13(2)7-6-8-14(3)9-10-16-11-17(21)12-18(22-5)19(16)15(4)20/h7,9,11-12,21H,6,8,10H2,1-5H3 |
InChI Key | JUCDMGAOGQOSAG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H26O3 |
Molecular Weight | 302.40 g/mol |
Exact Mass | 302.18819469 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 5.00 |
1-[2-(3,7-Dimethyl-2,6-octadien-1-yl)-4-hydroxy-6-methoxyphenyl]ethanone |
121379-44-0 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.32% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.71% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.88% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.93% | 94.73% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 89.19% | 92.08% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.46% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 87.35% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.45% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.08% | 96.00% |
CHEMBL2535 | P11166 | Glucose transporter | 85.43% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.96% | 90.00% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 81.85% | 90.20% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.25% | 91.19% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.10% | 96.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.07% | 85.14% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.99% | 97.21% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.86% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.02% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dioscorea bulbifera |
PubChem | 129836352 |
LOTUS | LTS0133547 |
wikiData | Q105135140 |