1-[(1R)-1,3-dimethylcyclohex-3-en-1-yl]-4-methylbenzene
| Internal ID | f768e370-a433-4c93-bd12-9536aef1e439 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Toluenes |
| IUPAC Name | 1-[(1R)-1,3-dimethylcyclohex-3-en-1-yl]-4-methylbenzene |
| SMILES (Canonical) | CC1=CCCC(C1)(C)C2=CC=C(C=C2)C |
| SMILES (Isomeric) | CC1=CCC[C@@](C1)(C)C2=CC=C(C=C2)C |
| InChI | InChI=1S/C15H20/c1-12-6-8-14(9-7-12)15(3)10-4-5-13(2)11-15/h5-9H,4,10-11H2,1-3H3/t15-/m1/s1 |
| InChI Key | CBJIDTHIVFGKJN-OAHLLOKOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.156500638 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 93.01% | 85.30% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.78% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.23% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.94% | 94.75% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.57% | 94.62% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.72% | 91.11% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 83.29% | 90.93% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.27% | 90.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.19% | 97.25% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.36% | 90.24% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.05% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 15101527 |
| LOTUS | LTS0070363 |
| wikiData | Q104952426 |