1-(1,3-Benzodioxol-5-yl)-3-(1-piperidinyl)-1-propanone
Internal ID | 02c54e52-0324-4191-97d5-a84327c1fcad |
Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-piperidin-1-ylpropan-1-one |
SMILES (Canonical) | C1CCN(CC1)CCC(=O)C2=CC3=C(C=C2)OCO3 |
SMILES (Isomeric) | C1CCN(CC1)CCC(=O)C2=CC3=C(C=C2)OCO3 |
InChI | InChI=1S/C15H19NO3/c17-13(6-9-16-7-2-1-3-8-16)12-4-5-14-15(10-12)19-11-18-14/h4-5,10H,1-3,6-9,11H2 |
InChI Key | DJXZMJWCDITTEO-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H19NO3 |
Molecular Weight | 261.32 g/mol |
Exact Mass | 261.13649347 g/mol |
Topological Polar Surface Area (TPSA) | 38.80 Ų |
XlogP | 2.20 |
Safrol Ii |
1-(1,3-Benzodioxol-5-yl)-3-(1-piperidinyl)-1-propanone |
30418-51-0 |
1-(1,3-benzodioxol-5-yl)-3-piperidin-1-ylpropan-1-one |
BRN 0259941 |
MLS000533308 |
1-Propanone, 1-(1,3-benzodioxol-5-yl)-3-(1-piperidinyl)- |
3',4'-(Methylenedioxy)-3-piperidinopropiophenone |
Propiophenone, 3',4'-(methylenedioxy)-3-piperidino- |
3-Piperidino-1-(3,4-methylenedioxyphenyl)-1-propanone |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
35481.3 nM |
Potency |
PMID: 22608855
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
25.1 nM 25.1 nM |
Potency Potency |
PMID: 25372480
via Super-PRED |
CHEMBL2039 | P27338 | Monoamine oxidase B |
3430 nM |
IC50 |
PMID: 23819826
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4208 | P20618 | Proteasome component C5 | 96.34% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.64% | 86.33% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 94.03% | 86.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.49% | 96.77% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 93.08% | 90.24% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.21% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 89.28% | 98.95% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 87.60% | 93.10% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.43% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.92% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.64% | 89.62% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.43% | 90.24% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.71% | 89.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.07% | 90.71% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.43% | 94.80% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.29% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper nigrum |
PubChem | 147354 |
NPASS | NPC469978 |
ChEMBL | CHEMBL1606959 |
LOTUS | LTS0085817 |
wikiData | Q27212986 |