1-(1-hydroxy-2-methylpropyl)-3a-methyl-7-methylidene-2,3,4,5,6,7a-hexahydro-1H-inden-4-ol
Internal ID | 034587b4-7607-4550-8a32-cf0c10656a8f |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 1-(1-hydroxy-2-methylpropyl)-3a-methyl-7-methylidene-2,3,4,5,6,7a-hexahydro-1H-inden-4-ol |
SMILES (Canonical) | CC(C)C(C1CCC2(C1C(=C)CCC2O)C)O |
SMILES (Isomeric) | CC(C)C(C1CCC2(C1C(=C)CCC2O)C)O |
InChI | InChI=1S/C15H26O2/c1-9(2)14(17)11-7-8-15(4)12(16)6-5-10(3)13(11)15/h9,11-14,16-17H,3,5-8H2,1-2,4H3 |
InChI Key | OZBVMKPZPKMEGY-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H26O2 |
Molecular Weight | 238.37 g/mol |
Exact Mass | 238.193280068 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 2.60 |
AKOS040736761 |
![2D Structure of 1-(1-hydroxy-2-methylpropyl)-3a-methyl-7-methylidene-2,3,4,5,6,7a-hexahydro-1H-inden-4-ol 2D Structure of 1-(1-hydroxy-2-methylpropyl)-3a-methyl-7-methylidene-2,3,4,5,6,7a-hexahydro-1H-inden-4-ol](https://plantaedb.com/storage/docs/compounds/2023/11/1-1-hydroxy-2-methylpropyl-3a-methyl-7-methylidene-234567a-hexahydro-1h-inden-4-ol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.37% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.32% | 90.17% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.00% | 94.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.17% | 91.11% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.57% | 96.38% |
CHEMBL2581 | P07339 | Cathepsin D | 90.43% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.40% | 96.09% |
CHEMBL1871 | P10275 | Androgen Receptor | 87.35% | 96.43% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.10% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 85.86% | 98.10% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.87% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.99% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.34% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.05% | 95.89% |
CHEMBL1977 | P11473 | Vitamin D receptor | 81.96% | 99.43% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.09% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dysoxylum variabile |
Erigeron annuus |
Jacobaea erucifolia subsp. argunensis |
Senecio vulgaris |
PubChem | 73814466 |
LOTUS | LTS0167874 |
wikiData | Q105203662 |