1,3,6-Trihydroxyxanthone
| Internal ID | 9c763d2d-6863-4c4d-a929-08bfc8def0cb |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 1,3,6-trihydroxyxanthen-9-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H8O5/c14-6-1-2-8-10(4-6)18-11-5-7(15)3-9(16)12(11)13(8)17/h1-5,14-16H |
| InChI Key | WRIILVBYWBDSMT-UHFFFAOYSA-N |
| Popularity | 18 references in papers |
| Molecular Formula | C13H8O5 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.03717335 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 2.40 |
| 1,3,6-trihydroxy-9H-xanthen-9-one |
| 1,3,6-trihydroxyxanthen-9-one |
| 39731-47-0 |
| CHEMBL468353 |
| SCHEMBL9838788 |
| WRIILVBYWBDSMT-UHFFFAOYSA-N |
| GLXC-20049 |
| 1,3,6-trihydroxyxanthen-9-one; 1,3,6-trihydroxy-9H-xanthen-9-one |
| CS-0255273 |
| G86249 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.56% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.95% | 89.00% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 92.54% | 96.12% |
| CHEMBL3194 | P02766 | Transthyretin | 92.46% | 90.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.32% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.52% | 95.56% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 91.00% | 98.35% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.55% | 93.99% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.66% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.03% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.78% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.19% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.47% | 99.23% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.70% | 93.65% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.77% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Rhachidosorus mesosorus |
| PubChem | 10800304 |
| LOTUS | LTS0156400 |
| wikiData | Q105311315 |