[(2R,3R,4R,5R,6R)-5-hydroxy-6-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2-[[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]oxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
Internal ID | 576409ca-3696-4796-aaf6-79198129c122 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2R,3R,4R,5R,6R)-5-hydroxy-6-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2-[[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]oxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)OC)CC4C(C(C(CO4)O)O)O)OCCC5=CC(=C(C=C5)OC)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](O[C@@H]([C@H]2OC(=O)/C=C/C3=CC(=C(C=C3)O)OC)C[C@@H]4[C@@H]([C@H]([C@H](CO4)O)O)O)OCCC5=CC(=C(C=C5)OC)O)O)O)O)O |
InChI | InChI=1S/C36H48O18/c1-16-27(41)30(44)31(45)36(51-16)54-34-32(46)35(49-11-10-18-5-8-22(47-2)20(38)12-18)52-25(14-24-29(43)28(42)21(39)15-50-24)33(34)53-26(40)9-6-17-4-7-19(37)23(13-17)48-3/h4-9,12-13,16,21,24-25,27-39,41-46H,10-11,14-15H2,1-3H3/b9-6+/t16-,21-,24+,25+,27-,28-,29-,30+,31+,32+,33+,34+,35+,36-/m0/s1 |
InChI Key | LYZCFNXBZZIFFR-ZUXAPQPJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H48O18 |
Molecular Weight | 768.80 g/mol |
Exact Mass | 768.28406468 g/mol |
Topological Polar Surface Area (TPSA) | 273.00 Ų |
XlogP | -1.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.70% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.35% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.11% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.30% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.84% | 99.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.62% | 91.49% |
CHEMBL3194 | P02766 | Transthyretin | 92.05% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 89.18% | 98.95% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 87.17% | 85.31% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.59% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.56% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.33% | 94.73% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.08% | 97.36% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.98% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.95% | 90.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.57% | 86.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.60% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.67% | 95.50% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.50% | 92.94% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.48% | 94.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.42% | 92.98% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.07% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.68% | 97.09% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 81.32% | 97.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Verbascum spinosum |
PubChem | 163189826 |
LOTUS | LTS0072084 |
wikiData | Q105159692 |