(1S,5R,8R,9S,10R,11R,13R,14S,16S,17R,18S,19S)-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecane-10,13,19-triol
| Internal ID | 33276477-2c94-4162-8da6-9557781e2497 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Villanovane, atisane, trachylobane or helvifulvane diterpenoids > Atisane diterpenoids > Hetisine-type diterpenoid alkaloids |
| IUPAC Name | (1S,5R,8R,9S,10R,11R,13R,14S,16S,17R,18S,19S)-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecane-10,13,19-triol |
| SMILES (Canonical) | CC12CCCC34C1C5CC67C3C(C(C(C6C4N5C2)O)C(=C)C7O)O |
| SMILES (Isomeric) | C[C@@]12CCC[C@]34[C@@H]1[C@@H]5C[C@]67[C@H]3[C@@H]([C@H]([C@@H]([C@@H]6[C@H]4N5C2)O)C(=C)[C@H]7O)O |
| InChI | InChI=1S/C20H27NO3/c1-8-10-12(22)11-16-19-5-3-4-18(2)7-21(16)9(14(18)19)6-20(11,17(8)24)15(19)13(10)23/h9-17,22-24H,1,3-7H2,2H3/t9-,10-,11+,12-,13+,14+,15-,16+,17+,18-,19-,20+/m0/s1 |
| InChI Key | ARCMIZNKYWEFGC-GLYPKLSBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19909372 g/mol |
| Topological Polar Surface Area (TPSA) | 63.90 Ų |
| XlogP | 0.50 |
| There are no found synonyms. |
![2D Structure of (1S,5R,8R,9S,10R,11R,13R,14S,16S,17R,18S,19S)-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecane-10,13,19-triol](https://plantaedb.com/storage/docs/compounds/2023/11/0fa40cb0-871c-11ee-94ce-4192614a7549.jpg "2D Structure of (1S,5R,8R,9S,10R,11R,13R,14S,16S,17R,18S,19S)-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecane-10,13,19-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.32% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.10% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.97% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.79% | 90.17% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.84% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.57% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.02% | 97.09% |
| CHEMBL3137261 | O14744 | PRMT5/MEP50 complex | 83.94% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.91% | 98.95% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.48% | 95.50% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 82.82% | 94.78% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.64% | 82.69% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 80.20% | 88.81% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.04% | 91.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aconitum tanguticum |
| PubChem | 162930398 |
| LOTUS | LTS0246148 |
| wikiData | Q104917235 |