(Z)-N-[(12S,18S,21R,30S)-6,15,27-tris[3-[acetyl(hydroxy)amino]propyl]-18-(hydroxymethyl)-12-methyl-2,5,8,11,17,20,23,26,29-nonaoxo-21-propan-2-yl-1-oxa-4,7,10,13,16,19,22,25,28-nonazacyclohentriacont-30-yl]dec-3-enamide
| Internal ID | eb5dedf9-e8b8-4128-88a0-f41ae3ee79a6 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (Z)-N-[(12S,18S,21R,30S)-6,15,27-tris[3-[acetyl(hydroxy)amino]propyl]-18-(hydroxymethyl)-12-methyl-2,5,8,11,17,20,23,26,29-nonaoxo-21-propan-2-yl-1-oxa-4,7,10,13,16,19,22,25,28-nonazacyclohentriacont-30-yl]dec-3-enamide |
| SMILES (Canonical) | CCCCCCC=CCC(=O)NC1COC(=O)CNC(=O)C(NC(=O)CNC(=O)C(NCC(NC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(NC1=O)CCCN(C(=O)C)O)C(C)C)CO)CCCN(C(=O)C)O)C)CCCN(C(=O)C)O |
| SMILES (Isomeric) | CCCCCC/C=C\CC(=O)N[C@H]1COC(=O)CNC(=O)C(NC(=O)CNC(=O)[C@@H](NCC(NC(=O)[C@@H](NC(=O)[C@H](NC(=O)CNC(=O)C(NC1=O)CCCN(C(=O)C)O)C(C)C)CO)CCCN(C(=O)C)O)C)CCCN(C(=O)C)O |
| InChI | InChI=1S/C51H87N13O18/c1-8-9-10-11-12-13-14-21-41(69)58-40-30-82-44(72)28-55-47(74)37(19-16-23-63(80)34(6)67)57-42(70)26-53-46(73)32(4)52-25-36(18-15-22-62(79)33(5)66)56-49(76)39(29-65)60-51(78)45(31(2)3)61-43(71)27-54-48(75)38(59-50(40)77)20-17-24-64(81)35(7)68/h13-14,31-32,36-40,45,52,65,79-81H,8-12,15-30H2,1-7H3,(H,53,73)(H,54,75)(H,55,74)(H,56,76)(H,57,70)(H,58,69)(H,59,77)(H,60,78)(H,61,71)/b14-13-/t32-,36?,37?,38?,39-,40-,45+/m0/s1 |
| InChI Key | BWUSRHCTUVBKFG-HAMDDGJVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C51H87N13O18 |
| Molecular Weight | 1170.30 g/mol |
| Exact Mass | 1169.62920298 g/mol |
| Topological Polar Surface Area (TPSA) | 442.00 Ų |
| XlogP | -1.90 |
| Atomic LogP (AlogP) | -3.60 |
| H-Bond Acceptor | 19 |
| H-Bond Donor | 14 |
| Rotatable Bonds | 22 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5000 | 50.00% |
| Caco-2 | - | 0.8592 | 85.92% |
| Blood Brain Barrier | - | 0.7250 | 72.50% |
| Human oral bioavailability | - | 0.6286 | 62.86% |
| Subcellular localzation | Mitochondria | 0.5230 | 52.30% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.7962 | 79.62% |
| OATP1B3 inhibitior | + | 0.9207 | 92.07% |
| MATE1 inhibitior | - | 0.9612 | 96.12% |
| OCT2 inhibitior | - | 0.8750 | 87.50% |
| BSEP inhibitior | + | 0.9528 | 95.28% |
| P-glycoprotein inhibitior | + | 0.7439 | 74.39% |
| P-glycoprotein substrate | + | 0.8512 | 85.12% |
| CYP3A4 substrate | + | 0.7145 | 71.45% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8307 | 83.07% |
| CYP3A4 inhibition | + | 0.5131 | 51.31% |
| CYP2C9 inhibition | - | 0.8341 | 83.41% |
| CYP2C19 inhibition | - | 0.8142 | 81.42% |
| CYP2D6 inhibition | - | 0.8985 | 89.85% |
| CYP1A2 inhibition | - | 0.8631 | 86.31% |
| CYP2C8 inhibition | + | 0.7249 | 72.49% |
| CYP inhibitory promiscuity | - | 0.9902 | 99.02% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.7000 | 70.00% |
| Carcinogenicity (trinary) | Non-required | 0.4635 | 46.35% |
| Eye corrosion | - | 0.9792 | 97.92% |
| Eye irritation | - | 0.8970 | 89.70% |
| Skin irritation | - | 0.7561 | 75.61% |
| Skin corrosion | - | 0.9220 | 92.20% |
| Ames mutagenesis | - | 0.5700 | 57.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6628 | 66.28% |
| Micronuclear | + | 0.7900 | 79.00% |
| Hepatotoxicity | - | 0.6075 | 60.75% |
| skin sensitisation | - | 0.8340 | 83.40% |
| Respiratory toxicity | + | 0.7000 | 70.00% |
| Reproductive toxicity | + | 0.7333 | 73.33% |
| Mitochondrial toxicity | + | 0.8500 | 85.00% |
| Nephrotoxicity | + | 0.5590 | 55.90% |
| Acute Oral Toxicity (c) | III | 0.6138 | 61.38% |
| Estrogen receptor binding | + | 0.7188 | 71.88% |
| Androgen receptor binding | + | 0.7008 | 70.08% |
| Thyroid receptor binding | + | 0.5356 | 53.56% |
| Glucocorticoid receptor binding | + | 0.6124 | 61.24% |
| Aromatase binding | + | 0.6839 | 68.39% |
| PPAR gamma | + | 0.7252 | 72.52% |
| Honey bee toxicity | - | 0.7216 | 72.16% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | + | 0.6030 | 60.30% |
| Fish aquatic toxicity | + | 0.8611 | 86.11% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.33% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.10% | 98.95% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 98.71% | 90.08% |
| CHEMBL236 | P41143 | Delta opioid receptor | 98.06% | 99.35% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 96.50% | 93.10% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.21% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.92% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.45% | 94.45% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 94.66% | 96.90% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 94.09% | 95.50% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 93.45% | 95.93% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 91.73% | 89.34% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 91.55% | 97.64% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 91.47% | 94.66% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.45% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.20% | 89.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.73% | 97.29% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.57% | 90.17% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.41% | 96.38% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 89.53% | 96.11% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.13% | 95.71% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.96% | 98.59% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.77% | 96.47% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 88.76% | 91.03% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.69% | 95.83% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 86.58% | 88.56% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.55% | 89.63% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.54% | 99.23% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.14% | 92.88% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 85.83% | 92.12% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.81% | 98.75% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.80% | 94.33% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 85.50% | 98.03% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.28% | 93.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.89% | 90.71% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.47% | 97.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.91% | 97.14% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 83.55% | 92.32% |
| CHEMBL1801 | P00747 | Plasminogen | 83.42% | 92.44% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 83.39% | 90.24% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.41% | 92.86% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.14% | 94.73% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 81.99% | 96.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.70% | 100.00% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 81.61% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.52% | 97.09% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 81.14% | 90.93% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.55% | 92.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.13% | 100.00% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 80.04% | 96.76% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163122147 |
| LOTUS | LTS0268169 |
| wikiData | Q104947689 |