(3S)-4-[[(2R,3R,5R,10S,13R,14R,17R)-3-acetyloxy-17-[(2R,3R,6S)-2-acetyloxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl]oxy]-3-hydroxy-3-methyl-4-oxobutanoic acid
| Internal ID | df7f1f1a-956a-42b2-97a5-e4ff4a3a6741 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | (3S)-4-[[(2R,3R,5R,10S,13R,14R,17R)-3-acetyloxy-17-[(2R,3R,6S)-2-acetyloxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl]oxy]-3-hydroxy-3-methyl-4-oxobutanoic acid |
| SMILES (Canonical) | CC(=O)OC1C(CC2(C(C1(C)C)CCC3=C2CCC4(C3(CCC4C5CCC(OC5OC(=O)C)C(C)(C)O)C)C)C)OC(=O)C(C)(CC(=O)O)O |
| SMILES (Isomeric) | CC(=O)O[C@H]1[C@@H](C[C@]2([C@H](C1(C)C)CCC3=C2CC[C@]4([C@]3(CC[C@@H]4[C@H]5CC[C@H](O[C@@H]5OC(=O)C)C(C)(C)O)C)C)C)OC(=O)[C@](C)(CC(=O)O)O |
| InChI | InChI=1S/C39H60O11/c1-21(40)47-31-27(49-33(44)39(10,46)20-30(42)43)19-36(7)25-16-18-37(8)24(15-17-38(37,9)26(25)12-13-28(36)34(31,3)4)23-11-14-29(35(5,6)45)50-32(23)48-22(2)41/h23-24,27-29,31-32,45-46H,11-20H2,1-10H3,(H,42,43)/t23-,24-,27-,28+,29+,31+,32+,36-,37-,38+,39+/m1/s1 |
| InChI Key | BGFUQWFRECLECU-OYYUEUNCSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C39H60O11 |
| Molecular Weight | 704.90 g/mol |
| Exact Mass | 704.41356273 g/mol |
| Topological Polar Surface Area (TPSA) | 166.00 Ų |
| XlogP | 5.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.86% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.60% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.18% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.27% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.54% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.71% | 86.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.75% | 100.00% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 88.59% | 89.05% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 87.41% | 97.28% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.01% | 95.50% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.85% | 95.17% |
| CHEMBL5028 | O14672 | ADAM10 | 86.81% | 97.50% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.43% | 93.04% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.08% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.31% | 97.09% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.10% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.99% | 93.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.94% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163082904 |
| LOTUS | LTS0022121 |
| wikiData | Q104935505 |