(1S,3R,4R,5R)-3-(2-carboxyacetyl)oxy-5-[(E)-3-[4-[(2S,3R,4S,5S,6R)-6-[[(1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexanecarbonyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3-hydroxyphenyl]prop-2-enoyl]oxy-1,4-dihydroxycyclohexane-1-carboxylic acid
Internal ID | b5abbc4d-056a-4da3-b3ce-0c498bbc11cb |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | (1S,3R,4R,5R)-3-(2-carboxyacetyl)oxy-5-[(E)-3-[4-[(2S,3R,4S,5S,6R)-6-[[(1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexanecarbonyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3-hydroxyphenyl]prop-2-enoyl]oxy-1,4-dihydroxycyclohexane-1-carboxylic acid |
SMILES (Canonical) | C1C(C(C(CC1(C(=O)OCC2C(C(C(C(O2)OC3=C(C=C(C=C3)C=CC(=O)OC4CC(CC(C4O)OC(=O)CC(=O)O)(C(=O)O)O)O)O)O)O)O)OC(=O)C=CC5=CC(=C(C=C5)O)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@H]([C@@H](C[C@@]1(C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(C=C(C=C3)/C=C/C(=O)O[C@@H]4C[C@@](C[C@H]([C@H]4O)OC(=O)CC(=O)O)(C(=O)O)O)O)O)O)O)O)OC(=O)/C=C/C5=CC(=C(C=C5)O)O)O)O |
InChI | InChI=1S/C41H46O25/c42-19-5-1-17(9-20(19)43)3-7-29(48)62-24-15-41(60,12-22(45)32(24)51)39(58)61-16-27-34(53)35(54)36(55)37(66-27)65-23-6-2-18(10-21(23)44)4-8-30(49)63-25-13-40(59,38(56)57)14-26(33(25)52)64-31(50)11-28(46)47/h1-10,22,24-27,32-37,42-45,51-55,59-60H,11-16H2,(H,46,47)(H,56,57)/b7-3+,8-4+/t22-,24-,25-,26-,27-,32-,33+,34-,35+,36-,37-,40-,41+/m1/s1 |
InChI Key | DHPNADKGHOWBIT-QDUJPEEKSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C41H46O25 |
Molecular Weight | 938.80 g/mol |
Exact Mass | 938.23281695 g/mol |
Topological Polar Surface Area (TPSA) | 421.00 Ų |
XlogP | -2.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.79% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.05% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.68% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.01% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.64% | 89.00% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 91.16% | 85.31% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.81% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.58% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.64% | 95.56% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 88.36% | 95.83% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.31% | 95.50% |
CHEMBL3194 | P02766 | Transthyretin | 88.29% | 90.71% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.17% | 83.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.88% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.89% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.53% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.15% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.50% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.38% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.15% | 99.17% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.05% | 96.90% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.91% | 94.73% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.04% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum viarum |
PubChem | 71452599 |
LOTUS | LTS0155250 |
wikiData | Q104980705 |