[(1S,2S,7S,8aS)-7-(3-acetyloxyprop-1-en-2-yl)-7-hydroxy-1,8a-dimethyl-6-oxo-2,8-dihydro-1H-naphthalen-2-yl] (2E,4E,6R)-4,6-dimethylocta-2,4-dienoate
| Internal ID | e87fca76-9edc-4d19-a7a3-d9ac5b048813 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
| IUPAC Name | [(1S,2S,7S,8aS)-7-(3-acetyloxyprop-1-en-2-yl)-7-hydroxy-1,8a-dimethyl-6-oxo-2,8-dihydro-1H-naphthalen-2-yl] (2E,4E,6R)-4,6-dimethylocta-2,4-dienoate |
| SMILES (Canonical) | CCC(C)C=C(C)C=CC(=O)OC1C=CC2=CC(=O)C(CC2(C1C)C)(C(=C)COC(=O)C)O |
| SMILES (Isomeric) | CC[C@@H](C)/C=C(\C)/C=C/C(=O)O[C@H]1C=CC2=CC(=O)[C@](C[C@]2([C@@H]1C)C)(C(=C)COC(=O)C)O |
| InChI | InChI=1S/C27H36O6/c1-8-17(2)13-18(3)9-12-25(30)33-23-11-10-22-14-24(29)27(31,16-26(22,7)20(23)5)19(4)15-32-21(6)28/h9-14,17,20,23,31H,4,8,15-16H2,1-3,5-7H3/b12-9+,18-13+/t17-,20-,23+,26+,27+/m1/s1 |
| InChI Key | DNSSJKQHFCIVIW-MFGTWBFSSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.25118886 g/mol |
| Topological Polar Surface Area (TPSA) | 89.90 Ų |
| XlogP | 5.30 |
| There are no found synonyms. |
![2D Structure of [(1S,2S,7S,8aS)-7-(3-acetyloxyprop-1-en-2-yl)-7-hydroxy-1,8a-dimethyl-6-oxo-2,8-dihydro-1H-naphthalen-2-yl] (2E,4E,6R)-4,6-dimethylocta-2,4-dienoate](https://plantaedb.com/storage/docs/compounds/2023/11/0f106750-862c-11ee-951d-c5f09741d19e.jpg "2D Structure of [(1S,2S,7S,8aS)-7-(3-acetyloxyprop-1-en-2-yl)-7-hydroxy-1,8a-dimethyl-6-oxo-2,8-dihydro-1H-naphthalen-2-yl] (2E,4E,6R)-4,6-dimethylocta-2,4-dienoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.58% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.78% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.46% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.12% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.17% | 97.25% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.93% | 90.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.19% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.33% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.84% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.00% | 85.14% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.24% | 94.80% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.11% | 91.19% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.75% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.33% | 99.17% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.18% | 94.75% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.05% | 100.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.41% | 89.34% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.27% | 96.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.66% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162893665 |
| LOTUS | LTS0061236 |
| wikiData | Q104985723 |