8-[2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-4-yl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol
| Internal ID | a74facab-9b53-4720-b287-4e195a5e9cea |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
| IUPAC Name | 8-[2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-4-yl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES (Canonical) | C1C(C2=C(C=C(C=C2)O)OC1C3=CC(=C(C=C3)O)O)C4=C(C=C(C5=C4OC(C(C5)O)C6=CC(=C(C(=C6)O)O)O)O)O |
| SMILES (Isomeric) | C1C(C2=C(C=C(C=C2)O)OC1C3=CC(=C(C=C3)O)O)C4=C(C=C(C5=C4OC(C(C5)O)C6=CC(=C(C(=C6)O)O)O)O)O |
| InChI | InChI=1S/C30H26O11/c31-14-2-3-15-16(10-25(40-26(15)8-14)12-1-4-18(32)20(34)5-12)27-21(35)11-19(33)17-9-24(38)29(41-30(17)27)13-6-22(36)28(39)23(37)7-13/h1-8,11,16,24-25,29,31-39H,9-10H2 |
| InChI Key | FRQITQVLMVBGLT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H26O11 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 562.14751164 g/mol |
| Topological Polar Surface Area (TPSA) | 201.00 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
![2D Structure of 8-[2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-4-yl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol](https://plantaedb.com/storage/docs/compounds/2023/11/0ee39480-8743-11ee-9a5a-a1873e33c6ad.jpg "2D Structure of 8-[2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-4-yl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.73% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.84% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.58% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.10% | 83.82% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.04% | 99.15% |
| CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 92.65% | 96.42% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.52% | 94.45% |
| CHEMBL236 | P41143 | Delta opioid receptor | 89.22% | 99.35% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.16% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.56% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.53% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.62% | 95.89% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 86.36% | 85.11% |
| CHEMBL3194 | P02766 | Transthyretin | 85.89% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.06% | 86.33% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 84.15% | 88.48% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.43% | 93.40% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.25% | 98.95% |
| CHEMBL238 | Q01959 | Dopamine transporter | 82.79% | 95.88% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.63% | 85.14% |
| CHEMBL4422 | O14842 | Free fatty acid receptor 1 | 82.59% | 93.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.21% | 99.23% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 80.90% | 95.62% |
| CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 80.50% | 95.55% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.44% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.29% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Senna petersiana |
| PubChem | 162941610 |
| LOTUS | LTS0121051 |
| wikiData | Q105000366 |