5-hydroxy-2-(4-methoxyphenyl)-7-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one
Internal ID | bc5830ed-dd95-44c4-b891-cde129ce1284 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(4-methoxyphenyl)-7-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC=C(C=C5)OC)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC[C@@H]2[C@@H]([C@H]([C@@H]([C@@H](O2)OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC=C(C=C5)OC)O)O)O)O)O)O)O |
InChI | InChI=1S/C28H34O14/c1-11-21(31)23(33)25(35)27(39-11)38-10-19-22(32)24(34)26(36)28(42-19)40-14-7-15(29)20-16(30)9-17(41-18(20)8-14)12-3-5-13(37-2)6-4-12/h3-8,11,17,19,21-29,31-36H,9-10H2,1-2H3/t11-,17?,19-,21+,22+,23+,24-,25-,26+,27-,28-/m1/s1 |
InChI Key | RMCRQBAILCLJGU-ZBDUJKITSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H34O14 |
Molecular Weight | 594.60 g/mol |
Exact Mass | 594.19485575 g/mol |
Topological Polar Surface Area (TPSA) | 214.00 Ų |
XlogP | -0.70 |
There are no found synonyms. |
![2D Structure of 5-hydroxy-2-(4-methoxyphenyl)-7-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one 2D Structure of 5-hydroxy-2-(4-methoxyphenyl)-7-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/0eca2ec0-8595-11ee-aff1-15a53c7b62e1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.85% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.16% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.78% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 94.36% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.10% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.20% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.71% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.30% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.37% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.36% | 89.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.25% | 97.36% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.95% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.70% | 94.73% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.84% | 86.92% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.57% | 94.80% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.11% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.02% | 99.23% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.27% | 95.89% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.75% | 95.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.13% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mentha longifolia |
PubChem | 102464035 |
LOTUS | LTS0224983 |
wikiData | Q104415020 |