[19,20,22,23-Tetraacetyloxy-21-(acetyloxymethyl)-25,26-dihydroxy-3,15,26-trimethyl-6,16-dioxo-2,5,17-trioxa-11-azapentacyclo[16.7.1.01,21.03,24.07,12]hexacosa-7(12),8,10-trien-15-yl] benzoate
Internal ID | d440a18c-8ee6-4ecd-886c-d4aee8befdb8 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | [19,20,22,23-tetraacetyloxy-21-(acetyloxymethyl)-25,26-dihydroxy-3,15,26-trimethyl-6,16-dioxo-2,5,17-trioxa-11-azapentacyclo[16.7.1.01,21.03,24.07,12]hexacosa-7(12),8,10-trien-15-yl] benzoate |
SMILES (Canonical) | CC(=O)OCC12C(C(C3C(C14C(C(C(C2OC(=O)C)OC(=O)C)OC(=O)C(CCC5=C(C=CC=N5)C(=O)OCC3(O4)C)(C)OC(=O)C6=CC=CC=C6)(C)O)O)OC(=O)C)OC(=O)C |
SMILES (Isomeric) | CC(=O)OCC12C(C(C3C(C14C(C(C(C2OC(=O)C)OC(=O)C)OC(=O)C(CCC5=C(C=CC=N5)C(=O)OCC3(O4)C)(C)OC(=O)C6=CC=CC=C6)(C)O)O)OC(=O)C)OC(=O)C |
InChI | InChI=1S/C43H49NO19/c1-21(45)55-20-42-34(59-24(4)48)30(57-22(2)46)29-32(50)43(42)41(8,54)33(31(58-23(3)47)35(42)60-25(5)49)61-38(53)39(6,62-36(51)26-13-10-9-11-14-26)17-16-28-27(15-12-18-44-28)37(52)56-19-40(29,7)63-43/h9-15,18,29-35,50,54H,16-17,19-20H2,1-8H3 |
InChI Key | VMWSZLNWXFHOTG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C43H49NO19 |
Molecular Weight | 883.80 g/mol |
Exact Mass | 883.28987833 g/mol |
Topological Polar Surface Area (TPSA) | 273.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.40% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.39% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.50% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.21% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 96.61% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.13% | 85.14% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 95.08% | 81.11% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.48% | 82.69% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.14% | 99.23% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.33% | 94.62% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 92.10% | 94.08% |
CHEMBL5028 | O14672 | ADAM10 | 86.50% | 97.50% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.01% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.79% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.05% | 94.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.82% | 91.11% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.63% | 96.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.02% | 93.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.56% | 91.07% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.25% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.16% | 95.50% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.98% | 96.67% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.52% | 83.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.27% | 92.62% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.78% | 100.00% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 80.34% | 87.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tripterygium wilfordii |
PubChem | 73156437 |
LOTUS | LTS0242178 |
wikiData | Q105289359 |