5-[[4-amino-1-[[18-(4-aminobutyl)-9-(2-amino-2-oxoethyl)-3-butan-2-yl-6-(2-carboxyethyl)-15-[carboxy(hydroxy)methyl]-21-(carboxymethyl)-24,28,31-trimethyl-2,5,8,11,14,17,20,23,26,29-decaoxo-1-oxa-4,7,10,13,16,19,22,25,28-nonazacyclohentriacont-30-yl]amino]-1,4-dioxobutan-2-yl]amino]-4-[[3-(1H-indol-3-yl)-2-(8-methyldecanoylamino)propanoyl]amino]-5-oxopentanoic acid
| Internal ID | ca2d6ad4-f90b-4106-8cb3-84003c778269 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 5-[[4-amino-1-[[18-(4-aminobutyl)-9-(2-amino-2-oxoethyl)-3-butan-2-yl-6-(2-carboxyethyl)-15-[carboxy(hydroxy)methyl]-21-(carboxymethyl)-24,28,31-trimethyl-2,5,8,11,14,17,20,23,26,29-decaoxo-1-oxa-4,7,10,13,16,19,22,25,28-nonazacyclohentriacont-30-yl]amino]-1,4-dioxobutan-2-yl]amino]-4-[[3-(1H-indol-3-yl)-2-(8-methyldecanoylamino)propanoyl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CCC(C)CCCCCCC(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)N)C(=O)NC3C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CN(C3=O)C)C)CC(=O)O)CCCCN)C(C(=O)O)O)CC(=O)N)CCC(=O)O)C(C)CC)C |
| SMILES (Isomeric) | CCC(C)CCCCCCC(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)N)C(=O)NC3C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CN(C3=O)C)C)CC(=O)O)CCCCN)C(C(=O)O)O)CC(=O)N)CCC(=O)O)C(C)CC)C |
| InChI | InChI=1S/C72H109N17O26/c1-8-35(3)18-12-10-11-13-22-51(92)79-45(28-39-32-76-41-20-15-14-19-40(39)41)65(106)82-43(23-25-54(95)96)62(103)85-47(30-50(75)91)68(109)87-58-38(6)115-72(114)57(36(4)9-2)86-64(105)44(24-26-55(97)98)83-66(107)46(29-49(74)90)80-52(93)33-77-69(110)59(60(101)71(112)113)88-63(104)42(21-16-17-27-73)81-67(108)48(31-56(99)100)84-61(102)37(5)78-53(94)34-89(7)70(58)111/h14-15,19-20,32,35-38,42-48,57-60,76,101H,8-13,16-18,21-31,33-34,73H2,1-7H3,(H2,74,90)(H2,75,91)(H,77,110)(H,78,94)(H,79,92)(H,80,93)(H,81,108)(H,82,106)(H,83,107)(H,84,102)(H,85,103)(H,86,105)(H,87,109)(H,88,104)(H,95,96)(H,97,98)(H,99,100)(H,112,113) |
| InChI Key | YJELKMKOEUUGFH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C72H109N17O26 |
| Molecular Weight | 1628.70 g/mol |
| Exact Mass | 1627.77296665 g/mol |
| Topological Polar Surface Area (TPSA) | 693.00 Ų |
| XlogP | -4.90 |
| Atomic LogP (AlogP) | -5.45 |
| H-Bond Acceptor | 23 |
| H-Bond Donor | 21 |
| Rotatable Bonds | 37 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5985 | 59.85% |
| Caco-2 | - | 0.8625 | 86.25% |
| Blood Brain Barrier | - | 0.9000 | 90.00% |
| Human oral bioavailability | - | 0.7000 | 70.00% |
| Subcellular localzation | Lysosomes | 0.4443 | 44.43% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8124 | 81.24% |
| OATP1B3 inhibitior | + | 0.9167 | 91.67% |
| MATE1 inhibitior | - | 0.7609 | 76.09% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | + | 0.9447 | 94.47% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.8815 | 88.15% |
| CYP3A4 substrate | + | 0.7551 | 75.51% |
| CYP2C9 substrate | - | 0.7932 | 79.32% |
| CYP2D6 substrate | - | 0.8004 | 80.04% |
| CYP3A4 inhibition | - | 0.8325 | 83.25% |
| CYP2C9 inhibition | - | 0.8617 | 86.17% |
| CYP2C19 inhibition | - | 0.8868 | 88.68% |
| CYP2D6 inhibition | - | 0.9175 | 91.75% |
| CYP1A2 inhibition | - | 0.9252 | 92.52% |
| CYP2C8 inhibition | + | 0.8213 | 82.13% |
| CYP inhibitory promiscuity | - | 0.9600 | 96.00% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8900 | 89.00% |
| Carcinogenicity (trinary) | Non-required | 0.5915 | 59.15% |
| Eye corrosion | - | 0.9885 | 98.85% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7757 | 77.57% |
| Skin corrosion | - | 0.9289 | 92.89% |
| Ames mutagenesis | - | 0.8137 | 81.37% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7045 | 70.45% |
| Micronuclear | + | 0.8200 | 82.00% |
| Hepatotoxicity | - | 0.6250 | 62.50% |
| skin sensitisation | - | 0.8837 | 88.37% |
| Respiratory toxicity | + | 0.7778 | 77.78% |
| Reproductive toxicity | + | 0.9778 | 97.78% |
| Mitochondrial toxicity | + | 0.9375 | 93.75% |
| Nephrotoxicity | + | 0.6355 | 63.55% |
| Acute Oral Toxicity (c) | III | 0.5512 | 55.12% |
| Estrogen receptor binding | - | 0.5379 | 53.79% |
| Androgen receptor binding | + | 0.7161 | 71.61% |
| Thyroid receptor binding | + | 0.7952 | 79.52% |
| Glucocorticoid receptor binding | + | 0.8405 | 84.05% |
| Aromatase binding | + | 0.8189 | 81.89% |
| PPAR gamma | + | 0.7797 | 77.97% |
| Honey bee toxicity | - | 0.6344 | 63.44% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5700 | 57.00% |
| Fish aquatic toxicity | + | 0.6934 | 69.34% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.87% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.63% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.41% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.40% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.23% | 83.82% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 98.42% | 93.10% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.57% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.92% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.82% | 85.14% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 96.67% | 96.11% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 95.49% | 97.64% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 95.34% | 90.20% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.79% | 93.99% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 94.51% | 98.33% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 93.61% | 88.42% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 92.90% | 98.05% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 92.73% | 93.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 92.57% | 96.90% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.53% | 97.14% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.17% | 96.47% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 91.94% | 96.31% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.63% | 90.08% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 91.57% | 82.38% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 91.40% | 97.23% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 90.97% | 95.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 90.80% | 92.32% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.41% | 99.23% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.78% | 90.17% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 89.61% | 91.81% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.83% | 94.45% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.81% | 89.50% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.68% | 94.75% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 88.51% | 88.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.39% | 97.09% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 88.36% | 85.83% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 87.64% | 94.66% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 86.24% | 96.28% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 85.83% | 98.59% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 85.44% | 95.56% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 84.91% | 93.18% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.86% | 97.00% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 84.17% | 96.25% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 83.84% | 82.86% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.91% | 89.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.55% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.53% | 95.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.28% | 86.33% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.75% | 95.38% |
| CHEMBL4071 | P08311 | Cathepsin G | 81.62% | 94.64% |
| CHEMBL1949 | P62937 | Cyclophilin A | 81.23% | 98.57% |
| CHEMBL4801 | P29466 | Caspase-1 | 80.72% | 96.85% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.18% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 59669658 |
| LOTUS | LTS0126775 |
| wikiData | Q104201759 |