[(3aR,4R,6aR,9aR,9bR)-9-methyl-3,6-dimethylidene-2-oxo-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl] acetate
| Internal ID | 0d5f4f4d-e0ec-422a-ae39-b440e76209e2 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Guaianolides and derivatives |
| IUPAC Name | [(3aR,4R,6aR,9aR,9bR)-9-methyl-3,6-dimethylidene-2-oxo-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl] acetate |
| SMILES (Canonical) | CC1=C(CC2C1C3C(C(CC2=C)OC(=O)C)C(=C)C(=O)O3)OC4C(C(C(C(O4)CO)O)O)O |
| SMILES (Isomeric) | CC1=C(C[C@@H]2[C@H]1[C@@H]3[C@@H]([C@@H](CC2=C)OC(=O)C)C(=C)C(=O)O3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
| InChI | InChI=1S/C23H30O10/c1-8-5-14(30-11(4)25)17-10(3)22(29)33-21(17)16-9(2)13(6-12(8)16)31-23-20(28)19(27)18(26)15(7-24)32-23/h12,14-21,23-24,26-28H,1,3,5-7H2,2,4H3/t12-,14+,15+,16-,17+,18+,19-,20+,21+,23+/m0/s1 |
| InChI Key | ANQNAMJQPPYLQX-XOGPGSAUSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C23H30O10 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.18389715 g/mol |
| Topological Polar Surface Area (TPSA) | 152.00 Ų |
| XlogP | -0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.70% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.04% | 91.11% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 95.08% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.40% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.46% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.93% | 95.56% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.71% | 97.79% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.52% | 97.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.92% | 94.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.41% | 95.50% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.28% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.78% | 99.17% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.49% | 95.89% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.13% | 97.36% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.91% | 96.37% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.14% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lapsana communis |
| PubChem | 101034739 |
| LOTUS | LTS0169891 |
| wikiData | Q104915357 |