[(3S)-5-[(1S,4aR,8aS)-5,5,8a-trimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]-3-methylpentyl] (3S)-5-[(1S,4aR,8aS)-5,5,8a-trimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoate
Internal ID | e4a802eb-59de-48cd-b1f2-6a42e0ee6956 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | [(3S)-5-[(1S,4aR,8aS)-5,5,8a-trimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]-3-methylpentyl] (3S)-5-[(1S,4aR,8aS)-5,5,8a-trimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoate |
SMILES (Canonical) | CC(CCC1C(=C)CCC2C1(CCC(=O)C2(C)C)C)CCOC(=O)CC(C)CCC3C(=C)CCC4C3(CCC(=O)C4(C)C)C |
SMILES (Isomeric) | C[C@@H](CC[C@H]1C(=C)CC[C@@H]2[C@]1(CCC(=O)C2(C)C)C)CCOC(=O)C[C@@H](C)CC[C@H]3C(=C)CC[C@@H]4[C@]3(CCC(=O)C4(C)C)C |
InChI | InChI=1S/C40H64O4/c1-26(11-15-30-28(3)13-17-32-37(5,6)34(41)19-22-39(30,32)9)21-24-44-36(43)25-27(2)12-16-31-29(4)14-18-33-38(7,8)35(42)20-23-40(31,33)10/h26-27,30-33H,3-4,11-25H2,1-2,5-10H3/t26-,27-,30-,31-,32-,33-,39-,40-/m0/s1 |
InChI Key | XQDCOJOGYBLPKT-UYQUZLKHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H64O4 |
Molecular Weight | 608.90 g/mol |
Exact Mass | 608.48046052 g/mol |
Topological Polar Surface Area (TPSA) | 60.40 Ų |
XlogP | 9.70 |
There are no found synonyms. |
![2D Structure of [(3S)-5-[(1S,4aR,8aS)-5,5,8a-trimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]-3-methylpentyl] (3S)-5-[(1S,4aR,8aS)-5,5,8a-trimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoate 2D Structure of [(3S)-5-[(1S,4aR,8aS)-5,5,8a-trimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]-3-methylpentyl] (3S)-5-[(1S,4aR,8aS)-5,5,8a-trimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoate](https://plantaedb.com/storage/docs/compounds/2023/11/0e478250-85f7-11ee-9412-47920126c6aa.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.58% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.42% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.53% | 90.17% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.67% | 82.69% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.22% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.28% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.83% | 96.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.46% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 84.46% | 98.95% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 84.02% | 92.98% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.64% | 99.23% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.23% | 96.47% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.43% | 91.19% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.42% | 96.38% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.75% | 100.00% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.81% | 90.08% |
CHEMBL238 | Q01959 | Dopamine transporter | 80.20% | 95.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Moldenhawera nutans |
PubChem | 163106607 |
LOTUS | LTS0094312 |
wikiData | Q105339640 |