methyl (1S,4aS,5S,6R,7S,7aS)-7-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxymethyl]-5,6-dihydroxy-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
Internal ID | d339457f-c74d-4c21-92c8-196b30575984 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl (1S,4aS,5S,6R,7S,7aS)-7-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxymethyl]-5,6-dihydroxy-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | COC(=O)C1=COC(C2C1C(C(C2COC(=O)C=CC3=CC(=C(C=C3)O)O)O)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC(=O)C1=CO[C@H]([C@H]2[C@@H]1[C@@H]([C@@H]([C@@H]2COC(=O)/C=C/C3=CC(=C(C=C3)O)O)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C26H32O15/c1-37-24(36)12-9-39-25(41-26-23(35)22(34)20(32)15(7-27)40-26)18-11(19(31)21(33)17(12)18)8-38-16(30)5-3-10-2-4-13(28)14(29)6-10/h2-6,9,11,15,17-23,25-29,31-35H,7-8H2,1H3/b5-3+/t11-,15-,17-,18-,19-,20-,21+,22+,23-,25+,26+/m1/s1 |
InChI Key | MHNHQOVNRYKGDF-WBDXUMFHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H32O15 |
Molecular Weight | 584.50 g/mol |
Exact Mass | 584.17412031 g/mol |
Topological Polar Surface Area (TPSA) | 242.00 Ų |
XlogP | -1.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.17% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.82% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.15% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.19% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.56% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.29% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.21% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.48% | 90.00% |
CHEMBL3194 | P02766 | Transthyretin | 83.87% | 90.71% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.45% | 90.17% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.78% | 95.83% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 81.56% | 88.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.62% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 80.61% | 98.95% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.46% | 90.71% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.06% | 96.90% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.03% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nyctanthes arbor-tristis |
PubChem | 14632886 |
LOTUS | LTS0228577 |
wikiData | Q105163890 |