3,4-Dihydroxy-2-[[5-hydroxy-2-(7-hydroxy-6-methylhepta-2,5-dien-2-yl)-5-methylcyclopent-2-en-1-yl]methyl]cyclohex-2-en-1-one
| Internal ID | e6e1995c-9a10-4c8a-b5e8-90e712847879 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 3,4-dihydroxy-2-[[5-hydroxy-2-(7-hydroxy-6-methylhepta-2,5-dien-2-yl)-5-methylcyclopent-2-en-1-yl]methyl]cyclohex-2-en-1-one |
| SMILES (Canonical) | CC(=CCC=C(C)C1=CCC(C1CC2=C(C(CCC2=O)O)O)(C)O)CO |
| SMILES (Isomeric) | CC(=CCC=C(C)C1=CCC(C1CC2=C(C(CCC2=O)O)O)(C)O)CO |
| InChI | InChI=1S/C21H30O5/c1-13(12-22)5-4-6-14(2)15-9-10-21(3,26)17(15)11-16-18(23)7-8-19(24)20(16)25/h5-6,9,17,19,22,24-26H,4,7-8,10-12H2,1-3H3 |
| InChI Key | QRYXQJUTSISTPF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.20932405 g/mol |
| Topological Polar Surface Area (TPSA) | 98.00 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
![2D Structure of 3,4-Dihydroxy-2-[[5-hydroxy-2-(7-hydroxy-6-methylhepta-2,5-dien-2-yl)-5-methylcyclopent-2-en-1-yl]methyl]cyclohex-2-en-1-one](https://plantaedb.com/storage/docs/compounds/2023/11/0db62170-854e-11ee-bcd7-83ac99f051cb.jpg "2D Structure of 3,4-Dihydroxy-2-[[5-hydroxy-2-(7-hydroxy-6-methylhepta-2,5-dien-2-yl)-5-methylcyclopent-2-en-1-yl]methyl]cyclohex-2-en-1-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.52% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.40% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.41% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.10% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.99% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.76% | 94.75% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.27% | 97.25% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.80% | 82.69% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.93% | 91.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.20% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.03% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.26% | 95.93% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.24% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.61% | 92.94% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.12% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.65% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.49% | 86.33% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.11% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162878551 |
| LOTUS | LTS0085015 |
| wikiData | Q104196140 |