[6-[6-[[4-[3-[3,4-Dihydroxy-6-methyl-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-3-methylpent-4-enyl]-3,4,8,8a-tetramethyl-1,2,3,4a,5,6-hexahydronaphthalen-1-yl]oxy]-4,5-dihydroxy-2-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate
Internal ID | 502aae5d-5167-4a77-9c70-8f440620a749 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | [6-[6-[[4-[3-[3,4-dihydroxy-6-methyl-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-3-methylpent-4-enyl]-3,4,8,8a-tetramethyl-1,2,3,4a,5,6-hexahydronaphthalen-1-yl]oxy]-4,5-dihydroxy-2-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
SMILES (Canonical) | CC1CC(C2(C(C1(C)CCC(C)(C=C)OC3C(C(C(C(O3)C)OC4C(C(C(C(O4)C)O)O)O)O)O)CCC=C2C)C)OC5C(C(C(C(O5)C)OC6C(C(C(C(O6)COC(=O)C)O)O)O)O)O |
SMILES (Isomeric) | CC1CC(C2(C(C1(C)CCC(C)(C=C)OC3C(C(C(C(O3)C)OC4C(C(C(C(O4)C)O)O)O)O)O)CCC=C2C)C)OC5C(C(C(C(O5)C)OC6C(C(C(C(O6)COC(=O)C)O)O)O)O)O |
InChI | InChI=1S/C46H76O20/c1-11-44(8,66-43-37(57)33(53)39(23(6)61-43)64-41-34(54)30(50)28(48)21(4)59-41)15-16-45(9)20(3)17-27(46(10)19(2)13-12-14-26(45)46)63-40-36(56)32(52)38(22(5)60-40)65-42-35(55)31(51)29(49)25(62-42)18-58-24(7)47/h11,13,20-23,25-43,48-57H,1,12,14-18H2,2-10H3 |
InChI Key | YGAXNRUXTMXSJA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H76O20 |
Molecular Weight | 949.10 g/mol |
Exact Mass | 948.49299481 g/mol |
Topological Polar Surface Area (TPSA) | 302.00 Ų |
XlogP | -0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.26% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.89% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.77% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.40% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.87% | 97.09% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.71% | 97.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.10% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.71% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 89.45% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.26% | 92.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.94% | 99.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.69% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.65% | 95.89% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.18% | 93.04% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.70% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.19% | 97.36% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.07% | 96.61% |
CHEMBL5028 | O14672 | ADAM10 | 82.94% | 97.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.56% | 91.19% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.61% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.32% | 95.89% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.22% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dicranopteris linearis |
Dicranopteris pedata |
PubChem | 74949888 |
LOTUS | LTS0148278 |
wikiData | Q105347943 |