(2R,3S,4S)-4-[[(E)-2-[[(2R,3R)-2-[[2-[[(2S,3S,4Z,6E,8R)-2,3-dihydroxy-2,6,8-trimethyldeca-4,6-dienoyl]amino]acetyl]amino]-3-hydroxybutanoyl]amino]but-2-enoyl]amino]-N'-[(3R,6R,9S,15R,18R,19R,22S)-6-[(1R)-1-hydroxyethyl]-3-[(R)-(4-hydroxyphenyl)-methoxymethyl]-15-(methoxymethyl)-9-methyl-2,5,8,11,14,17,21-heptaoxo-19-propan-2-yl-20-oxa-1,4,7,10,13,16-hexazabicyclo[20.4.0]hexacosan-18-yl]-2,3-dimethylpentanediamide
| Internal ID | 64977546-d529-4ec7-bde9-a09baf7cac27 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (2R,3S,4S)-4-[[(E)-2-[[(2R,3R)-2-[[2-[[(2S,3S,4Z,6E,8R)-2,3-dihydroxy-2,6,8-trimethyldeca-4,6-dienoyl]amino]acetyl]amino]-3-hydroxybutanoyl]amino]but-2-enoyl]amino]-N'-[(3R,6R,9S,15R,18R,19R,22S)-6-[(1R)-1-hydroxyethyl]-3-[(R)-(4-hydroxyphenyl)-methoxymethyl]-15-(methoxymethyl)-9-methyl-2,5,8,11,14,17,21-heptaoxo-19-propan-2-yl-20-oxa-1,4,7,10,13,16-hexazabicyclo[20.4.0]hexacosan-18-yl]-2,3-dimethylpentanediamide |
| SMILES (Canonical) | CCC(C)C=C(C)C=CC(C(C)(C(=O)NCC(=O)NC(C(C)O)C(=O)NC(=CC)C(=O)NC(C(C)C(C)C(=O)N)C(=O)NC1C(OC(=O)C2CCCCN2C(=O)C(NC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(NC1=O)COC)C)C(C)O)C(C3=CC=C(C=C3)O)OC)C(C)C)O)O |
| SMILES (Isomeric) | CC[C@@H](C)/C=C(\C)/C=C\[C@@H]([C@@](C)(C(=O)NCC(=O)N[C@H]([C@@H](C)O)C(=O)N/C(=C/C)/C(=O)N[C@@H]([C@@H](C)[C@@H](C)C(=O)N)C(=O)N[C@@H]1[C@H](OC(=O)[C@@H]2CCCCN2C(=O)[C@H](NC(=O)[C@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](NC1=O)COC)C)[C@@H](C)O)[C@@H](C3=CC=C(C=C3)O)OC)C(C)C)O)O |
| InChI | InChI=1S/C65H100N12O21/c1-15-32(5)27-33(6)20-25-44(81)65(12,95)64(94)68-29-46(83)72-48(37(10)78)59(89)70-41(16-2)57(87)73-47(34(7)35(8)54(66)84)58(88)75-50-52(31(3)4)98-63(93)43-19-17-18-26-77(43)62(92)51(53(97-14)39-21-23-40(80)24-22-39)76-60(90)49(38(11)79)74-55(85)36(9)69-45(82)28-67-56(86)42(30-96-13)71-61(50)91/h16,20-25,27,31-32,34-38,42-44,47-53,78-81,95H,15,17-19,26,28-30H2,1-14H3,(H2,66,84)(H,67,86)(H,68,94)(H,69,82)(H,70,89)(H,71,91)(H,72,83)(H,73,87)(H,74,85)(H,75,88)(H,76,90)/b25-20-,33-27+,41-16+/t32-,34+,35-,36+,37-,38-,42-,43+,44+,47+,48-,49-,50-,51-,52-,53-,65+/m1/s1 |
| InChI Key | JHMVDIYMGNHGMP-RPNGFFCGSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C65H100N12O21 |
| Molecular Weight | 1385.60 g/mol |
| Exact Mass | 1384.71259825 g/mol |
| Topological Polar Surface Area (TPSA) | 500.00 Ų |
| XlogP | 0.10 |
| Atomic LogP (AlogP) | -3.47 |
| H-Bond Acceptor | 21 |
| H-Bond Donor | 16 |
| Rotatable Bonds | 26 |
| There are no found synonyms. |
![2D Structure of (2R,3S,4S)-4-[[(E)-2-[[(2R,3R)-2-[[2-[[(2S,3S,4Z,6E,8R)-2,3-dihydroxy-2,6,8-trimethyldeca-4,6-dienoyl]amino]acetyl]amino]-3-hydroxybutanoyl]amino]but-2-enoyl]amino]-N'-[(3R,6R,9S,15R,18R,19R,22S)-6-[(1R)-1-hydroxyethyl]-3-[(R)-(4-hydroxyphenyl)-methoxymethyl]-15-(methoxymethyl)-9-methyl-2,5,8,11,14,17,21-heptaoxo-19-propan-2-yl-20-oxa-1,4,7,10,13,16-hexazabicyclo[20.4.0]hexacosan-18-yl]-2,3-dimethylpentanediamide](https://plantaedb.com/storage/docs/compounds/2023/11/0d4c71a0-868c-11ee-bb81-09d0581b3942.jpg "2D Structure of (2R,3S,4S)-4-[[(E)-2-[[(2R,3R)-2-[[2-[[(2S,3S,4Z,6E,8R)-2,3-dihydroxy-2,6,8-trimethyldeca-4,6-dienoyl]amino]acetyl]amino]-3-hydroxybutanoyl]amino]but-2-enoyl]amino]-N'-[(3R,6R,9S,15R,18R,19R,22S)-6-[(1R)-1-hydroxyethyl]-3-[(R)-(4-hydroxyphenyl)-methoxymethyl]-15-(methoxymethyl)-9-methyl-2,5,8,11,14,17,21-heptaoxo-19-propan-2-yl-20-oxa-1,4,7,10,13,16-hexazabicyclo[20.4.0]hexacosan-18-yl]-2,3-dimethylpentanediamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5357 | 53.57% |
| Caco-2 | - | 0.8632 | 86.32% |
| Blood Brain Barrier | - | 0.9500 | 95.00% |
| Human oral bioavailability | - | 0.7714 | 77.14% |
| Subcellular localzation | Lysosomes | 0.5019 | 50.19% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.7945 | 79.45% |
| OATP1B3 inhibitior | + | 0.9289 | 92.89% |
| MATE1 inhibitior | - | 0.8446 | 84.46% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | + | 0.9716 | 97.16% |
| P-glycoprotein inhibitior | + | 0.7424 | 74.24% |
| P-glycoprotein substrate | + | 0.8816 | 88.16% |
| CYP3A4 substrate | + | 0.7573 | 75.73% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8686 | 86.86% |
| CYP3A4 inhibition | - | 0.8863 | 88.63% |
| CYP2C9 inhibition | - | 0.8623 | 86.23% |
| CYP2C19 inhibition | - | 0.8888 | 88.88% |
| CYP2D6 inhibition | - | 0.8645 | 86.45% |
| CYP1A2 inhibition | - | 0.8714 | 87.14% |
| CYP2C8 inhibition | + | 0.8569 | 85.69% |
| CYP inhibitory promiscuity | - | 0.9767 | 97.67% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9200 | 92.00% |
| Carcinogenicity (trinary) | Non-required | 0.5079 | 50.79% |
| Eye corrosion | - | 0.9848 | 98.48% |
| Eye irritation | - | 0.8960 | 89.60% |
| Skin irritation | - | 0.7534 | 75.34% |
| Skin corrosion | - | 0.9198 | 91.98% |
| Ames mutagenesis | - | 0.6954 | 69.54% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7226 | 72.26% |
| Micronuclear | + | 0.8700 | 87.00% |
| Hepatotoxicity | + | 0.5704 | 57.04% |
| skin sensitisation | - | 0.8501 | 85.01% |
| Respiratory toxicity | + | 0.7667 | 76.67% |
| Reproductive toxicity | + | 0.9444 | 94.44% |
| Mitochondrial toxicity | + | 0.8875 | 88.75% |
| Nephrotoxicity | + | 0.6239 | 62.39% |
| Acute Oral Toxicity (c) | III | 0.6512 | 65.12% |
| Estrogen receptor binding | + | 0.5412 | 54.12% |
| Androgen receptor binding | + | 0.7509 | 75.09% |
| Thyroid receptor binding | + | 0.7519 | 75.19% |
| Glucocorticoid receptor binding | + | 0.8078 | 80.78% |
| Aromatase binding | + | 0.7636 | 76.36% |
| PPAR gamma | + | 0.7942 | 79.42% |
| Honey bee toxicity | - | 0.6253 | 62.53% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.5600 | 56.00% |
| Fish aquatic toxicity | + | 0.7723 | 77.23% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.85% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.39% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.39% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.88% | 85.14% |
| CHEMBL236 | P41143 | Delta opioid receptor | 98.33% | 99.35% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.36% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.20% | 97.09% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 93.92% | 89.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.85% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.61% | 95.89% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 93.17% | 83.14% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.96% | 90.08% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 92.42% | 90.93% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 91.88% | 82.38% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 90.75% | 92.97% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.30% | 94.73% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 90.26% | 91.03% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.13% | 97.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.72% | 98.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.86% | 99.23% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 88.67% | 83.10% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.51% | 100.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.21% | 94.33% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 87.29% | 96.25% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 86.80% | 98.59% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.78% | 93.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 86.55% | 98.05% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.03% | 96.90% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 84.96% | 81.58% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.93% | 99.17% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.41% | 92.88% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.36% | 89.62% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 84.26% | 80.71% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.13% | 100.00% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 83.53% | 96.11% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.27% | 93.56% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 83.14% | 89.33% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.06% | 93.10% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.39% | 95.50% |
| CHEMBL3837 | P07711 | Cathepsin L | 82.08% | 96.61% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.59% | 94.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.59% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.97% | 90.00% |
| CHEMBL4616 | Q92847 | Ghrelin receptor | 80.59% | 92.00% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 80.55% | 97.31% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.54% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163194235 |
| LOTUS | LTS0057271 |
| wikiData | Q105128095 |