(3S,8R,9S,10R,13S,14S,17S)-17-[(1S)-1-hydroxy-2-methoxyethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol
| Internal ID | d77d63cd-529a-433a-8cf6-42bf2f182993 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Pregnane steroids > Gluco/mineralocorticoids, progestogins and derivatives |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17S)-17-[(1S)-1-hydroxy-2-methoxyethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol |
| SMILES (Canonical) | CC12CCC(CC1=CCC3C2CCC4(C3(CCC4(C(COC)O)O)O)C)O |
| SMILES (Isomeric) | C[C@]12CC[C@@H](CC1=CC[C@@H]3[C@@H]2CC[C@]4([C@@]3(CC[C@]4([C@H](COC)O)O)O)C)O |
| InChI | InChI=1S/C22H36O5/c1-19-8-6-15(23)12-14(19)4-5-17-16(19)7-9-20(2)21(17,25)10-11-22(20,26)18(24)13-27-3/h4,15-18,23-26H,5-13H2,1-3H3/t15-,16-,17+,18-,19-,20-,21-,22+/m0/s1 |
| InChI Key | DRWYRTBGYGOFNY-PVFHHWQTSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.25627424 g/mol |
| Topological Polar Surface Area (TPSA) | 90.20 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
![2D Structure of (3S,8R,9S,10R,13S,14S,17S)-17-[(1S)-1-hydroxy-2-methoxyethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol](https://plantaedb.com/storage/docs/compounds/2023/11/0d410520-866c-11ee-b0f4-afa0a3f10951.jpg "2D Structure of (3S,8R,9S,10R,13S,14S,17S)-17-[(1S)-1-hydroxy-2-methoxyethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.15% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.99% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.83% | 91.11% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 90.35% | 95.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.67% | 95.93% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.37% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.68% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.10% | 94.45% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 87.13% | 87.16% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.50% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.01% | 100.00% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.12% | 95.71% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.02% | 92.62% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.37% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.80% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.70% | 85.14% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 80.92% | 89.05% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.66% | 96.43% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.41% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Periploca sepium |
| PubChem | 162988264 |
| LOTUS | LTS0066014 |
| wikiData | Q104987688 |