[(9S)-4,5,9-trihydroxy-10-oxo-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]anthracen-2-yl]methyl (2R,3S)-2-methyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoate
Internal ID | dd3e02c9-04a0-4269-90f6-15551aecd139 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
IUPAC Name | [(9S)-4,5,9-trihydroxy-10-oxo-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]anthracen-2-yl]methyl (2R,3S)-2-methyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoate |
SMILES (Canonical) | CC(C(C)OC1C(C(C(C(O1)CO)O)O)O)C(=O)OCC2=CC3=C(C(=C2)O)C(=O)C4=C(C3(C5C(C(C(C(O5)CO)O)O)O)O)C=CC=C4O |
SMILES (Isomeric) | C[C@H]([C@H](C)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)C(=O)OCC2=CC3=C(C(=C2)O)C(=O)C4=C([C@]3([C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)C=CC=C4O |
InChI | InChI=1S/C32H40O17/c1-11(12(2)47-31-28(43)26(41)23(38)19(9-34)49-31)30(44)46-10-13-6-15-21(17(36)7-13)24(39)20-14(4-3-5-16(20)35)32(15,45)29-27(42)25(40)22(37)18(8-33)48-29/h3-7,11-12,18-19,22-23,25-29,31,33-38,40-43,45H,8-10H2,1-2H3/t11-,12+,18-,19-,22-,23-,25+,26+,27-,28-,29-,31-,32+/m1/s1 |
InChI Key | WSPTZOHIIFSZII-RGPYKSAXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H40O17 |
Molecular Weight | 696.60 g/mol |
Exact Mass | 696.22654980 g/mol |
Topological Polar Surface Area (TPSA) | 294.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.62% | 91.11% |
CHEMBL220 | P22303 | Acetylcholinesterase | 96.67% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 96.54% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.24% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.30% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.88% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.70% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.37% | 89.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.92% | 96.38% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.43% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.39% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.21% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.88% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.74% | 95.93% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.36% | 94.75% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.41% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.04% | 86.33% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.70% | 91.24% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.36% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.36% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.03% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.20% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.26% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.53% | 91.19% |
CHEMBL2535 | P11166 | Glucose transporter | 81.11% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aloe littoralis |
PubChem | 102316890 |
LOTUS | LTS0198325 |
wikiData | Q105312027 |