(10-Acetyloxy-2,7,13-trihydroxy-4,14,15,15-tetramethyl-3-oxo-5-tricyclo[9.3.1.14,8]hexadeca-1(14),8-dienyl) acetate
| Internal ID | 04d5838b-1de9-452d-a656-33479983ffc1 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Dicarboxylic acids and derivatives |
| IUPAC Name | (10-acetyloxy-2,7,13-trihydroxy-4,14,15,15-tetramethyl-3-oxo-5-tricyclo[9.3.1.14,8]hexadeca-1(14),8-dienyl) acetate |
| SMILES (Canonical) | CC1=C2C(C(=O)C3(CC(=CC(C(C2(C)C)CC1O)OC(=O)C)C(CC3OC(=O)C)O)C)O |
| SMILES (Isomeric) | CC1=C2C(C(=O)C3(CC(=CC(C(C2(C)C)CC1O)OC(=O)C)C(CC3OC(=O)C)O)C)O |
| InChI | InChI=1S/C24H34O8/c1-11-16(27)8-15-18(31-12(2)25)7-14-10-24(6,19(9-17(14)28)32-13(3)26)22(30)21(29)20(11)23(15,4)5/h7,15-19,21,27-29H,8-10H2,1-6H3 |
| InChI Key | JAOUGVQHSBJSPJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.22536804 g/mol |
| Topological Polar Surface Area (TPSA) | 130.00 Ų |
| XlogP | 0.10 |
| There are no found synonyms. |
![2D Structure of (10-Acetyloxy-2,7,13-trihydroxy-4,14,15,15-tetramethyl-3-oxo-5-tricyclo[9.3.1.14,8]hexadeca-1(14),8-dienyl) acetate](https://plantaedb.com/storage/docs/compounds/2023/11/0ce550a0-84aa-11ee-a70b-8d8b587f4fce.jpg "2D Structure of (10-Acetyloxy-2,7,13-trihydroxy-4,14,15,15-tetramethyl-3-oxo-5-tricyclo[9.3.1.14,8]hexadeca-1(14),8-dienyl) acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.99% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.88% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.50% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.66% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.96% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.49% | 89.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.94% | 95.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.18% | 91.19% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.51% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.38% | 98.95% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.87% | 97.79% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.18% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.17% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.11% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Taxus baccata |
| Taxus mairei |
| PubChem | 162937763 |
| LOTUS | LTS0223635 |
| wikiData | Q105123916 |