(2S,4S,8S)-5-methoxy-4-[[(2S,4S,8R)-5-methoxy-2-phenyl-8-prop-1-en-2-yl-3,4,8,9-tetrahydro-2H-furo[2,3-h]chromen-4-yl]oxy]-2-phenyl-8-prop-1-en-2-yl-3,4,8,9-tetrahydro-2H-furo[2,3-h]chromene
| Internal ID | 4e91a1a3-8802-43d0-9615-59a64ee77787 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 8-prenylated flavans |
| IUPAC Name | (2S,4S,8S)-5-methoxy-4-[[(2S,4S,8R)-5-methoxy-2-phenyl-8-prop-1-en-2-yl-3,4,8,9-tetrahydro-2H-furo[2,3-h]chromen-4-yl]oxy]-2-phenyl-8-prop-1-en-2-yl-3,4,8,9-tetrahydro-2H-furo[2,3-h]chromene |
| SMILES (Canonical) | CC(=C)C1CC2=C3C(=C(C=C2O1)OC)C(CC(O3)C4=CC=CC=C4)OC5CC(OC6=C7CC(OC7=CC(=C56)OC)C(=C)C)C8=CC=CC=C8 |
| SMILES (Isomeric) | CC(=C)[C@H]1CC2=C3C(=C(C=C2O1)OC)[C@H](C[C@H](O3)C4=CC=CC=C4)O[C@H]5C[C@H](OC6=C7C[C@H](OC7=CC(=C56)OC)C(=C)C)C8=CC=CC=C8 |
| InChI | InChI=1S/C42H42O7/c1-23(2)29-17-27-33(45-29)21-35(43-5)39-37(19-31(48-41(27)39)25-13-9-7-10-14-25)47-38-20-32(26-15-11-8-12-16-26)49-42-28-18-30(24(3)4)46-34(28)22-36(44-6)40(38)42/h7-16,21-22,29-32,37-38H,1,3,17-20H2,2,4-6H3/t29-,30+,31-,32-,37-,38-/m0/s1 |
| InChI Key | OMNOKOWDMQKTMV-GNWVKJIVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C42H42O7 |
| Molecular Weight | 658.80 g/mol |
| Exact Mass | 658.29305367 g/mol |
| Topological Polar Surface Area (TPSA) | 64.60 Ų |
| XlogP | 9.00 |
| There are no found synonyms. |
![2D Structure of (2S,4S,8S)-5-methoxy-4-[[(2S,4S,8R)-5-methoxy-2-phenyl-8-prop-1-en-2-yl-3,4,8,9-tetrahydro-2H-furo[2,3-h]chromen-4-yl]oxy]-2-phenyl-8-prop-1-en-2-yl-3,4,8,9-tetrahydro-2H-furo[2,3-h]chromene](https://plantaedb.com/storage/docs/compounds/2023/11/0cdaf450-85bc-11ee-8c1b-2fe3462d32b8.jpg "2D Structure of (2S,4S,8S)-5-methoxy-4-[[(2S,4S,8R)-5-methoxy-2-phenyl-8-prop-1-en-2-yl-3,4,8,9-tetrahydro-2H-furo[2,3-h]chromen-4-yl]oxy]-2-phenyl-8-prop-1-en-2-yl-3,4,8,9-tetrahydro-2H-furo[2,3-h]chromene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.61% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.16% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.80% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.71% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.89% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.28% | 91.49% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.29% | 95.89% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.22% | 97.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.47% | 99.17% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 83.44% | 94.03% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.08% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.61% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.93% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Tephrosia crassifolia |
| PubChem | 163186570 |
| LOTUS | LTS0110008 |
| wikiData | Q105194422 |