[(1S,4R,5R,8S,9R,10S,11S,13R,15S,16R)-9-acetyloxy-4-hydroxy-6,6,10,16-tetramethyl-17-oxo-3,12-dioxapentacyclo[13.2.1.01,11.05,10.011,13]octadecan-8-yl] acetate
| Internal ID | 41cb0d97-cad7-427b-bf17-05385afdec78 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
| IUPAC Name | [(1S,4R,5R,8S,9R,10S,11S,13R,15S,16R)-9-acetyloxy-4-hydroxy-6,6,10,16-tetramethyl-17-oxo-3,12-dioxapentacyclo[13.2.1.01,11.05,10.011,13]octadecan-8-yl] acetate |
| SMILES (Canonical) | CC1C2CC3C4(O3)C5(C(C(OCC4(C2)C1=O)O)C(CC(C5OC(=O)C)OC(=O)C)(C)C)C |
| SMILES (Isomeric) | C[C@@H]1[C@@H]2C[C@@H]3[C@]4(O3)[C@]5([C@H]([C@@H](OC[C@]4(C2)C1=O)O)C(C[C@@H]([C@@H]5OC(=O)C)OC(=O)C)(C)C)C |
| InChI | InChI=1S/C24H34O8/c1-11-14-7-16-24(32-16)22(6)17(20(28)29-10-23(24,8-14)18(11)27)21(4,5)9-15(30-12(2)25)19(22)31-13(3)26/h11,14-17,19-20,28H,7-10H2,1-6H3/t11-,14-,15+,16-,17-,19+,20-,22+,23-,24+/m1/s1 |
| InChI Key | MKQVTOBIWOSQKR-QUBKEVJASA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.22536804 g/mol |
| Topological Polar Surface Area (TPSA) | 112.00 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
![2D Structure of [(1S,4R,5R,8S,9R,10S,11S,13R,15S,16R)-9-acetyloxy-4-hydroxy-6,6,10,16-tetramethyl-17-oxo-3,12-dioxapentacyclo[13.2.1.01,11.05,10.011,13]octadecan-8-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/0cb8fda0-8561-11ee-a570-b1e43d4868d3.jpg "2D Structure of [(1S,4R,5R,8S,9R,10S,11S,13R,15S,16R)-9-acetyloxy-4-hydroxy-6,6,10,16-tetramethyl-17-oxo-3,12-dioxapentacyclo[13.2.1.01,11.05,10.011,13]octadecan-8-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.68% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.12% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.08% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.08% | 85.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.26% | 91.19% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.17% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.12% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.27% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.89% | 98.95% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.68% | 97.28% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.94% | 97.79% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.35% | 91.24% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.85% | 100.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.60% | 91.07% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.40% | 89.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.49% | 97.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.40% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Jungermannia exsertifolia |
| PubChem | 10456413 |
| LOTUS | LTS0126437 |
| wikiData | Q105166150 |