(2S)-2-[(3S,8S,9S,10R,13S,14S,16R,17R)-3-[(2R,3R,4R,5S,6R)-5-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-16-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-3-one
Internal ID | a16f5c2a-f6f7-43b5-a121-060880c3ffb3 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | (2S)-2-[(3S,8S,9S,10R,13S,14S,16R,17R)-3-[(2R,3R,4R,5S,6R)-5-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-16-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-3-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3CCC4(C5CCC6(C(C5CC=C4C3)CC(C6C(C)C(=O)CCC(C)COC7C(C(C(C(O7)CO)O)O)O)O)C)C)CO)OC8C(C(C(CO8)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O[C@H]3CC[C@@]4([C@H]5CC[C@]6([C@H]([C@@H]5CC=C4C3)C[C@H]([C@@H]6[C@H](C)C(=O)CCC(C)CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)C)C)CO)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O)O |
InChI | InChI=1S/C50H82O22/c1-20(18-65-45-41(63)37(59)36(58)31(16-51)69-45)6-9-28(53)21(2)33-29(54)15-27-25-8-7-23-14-24(10-12-49(23,4)26(25)11-13-50(27,33)5)68-47-42(64)39(61)43(32(17-52)70-47)71-48-44(38(60)34(56)22(3)67-48)72-46-40(62)35(57)30(55)19-66-46/h7,20-22,24-27,29-48,51-52,54-64H,6,8-19H2,1-5H3/t20?,21-,22+,24+,25-,26+,27+,29-,30-,31-,32-,33+,34+,35+,36-,37+,38-,39-,40-,41-,42-,43-,44-,45-,46+,47-,48+,49+,50+/m1/s1 |
InChI Key | XBEWXWDRJUIRLA-ROGQZMMHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C50H82O22 |
Molecular Weight | 1035.20 g/mol |
Exact Mass | 1034.52977424 g/mol |
Topological Polar Surface Area (TPSA) | 354.00 Ų |
XlogP | -2.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.09% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.54% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.64% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.56% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 95.82% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.57% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.25% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.71% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.69% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.45% | 95.89% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.89% | 89.05% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.76% | 93.56% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.63% | 92.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.66% | 96.00% |
CHEMBL5028 | O14672 | ADAM10 | 84.32% | 97.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.48% | 96.61% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.53% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.91% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.37% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.72% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.31% | 97.36% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.28% | 95.89% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.24% | 97.50% |
CHEMBL237 | P41145 | Kappa opioid receptor | 80.20% | 98.10% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.18% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum abutiloides |
PubChem | 10581912 |
LOTUS | LTS0195883 |
wikiData | Q105324353 |