[(3S,8S,9R,10R,12R,13S,14R,17R)-17-acetyl-8,14-dihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-3-phenylprop-2-enoate
Internal ID | 4ca45694-b948-4906-9b55-5326a730ff43 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(3S,8S,9R,10R,12R,13S,14R,17R)-17-acetyl-8,14-dihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-3-phenylprop-2-enoate |
SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4OC)OC5CCC6(C7CC(C8(C(CCC8(C7(CC=C6C5)O)O)C(=O)C)C)OC(=O)C=CC9=CC=CC=C9)C)C)C)C)OC)O |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H](C[C@@H](O1)O[C@@H]2[C@H](O[C@H](C[C@@H]2OC)O[C@@H]3[C@H](O[C@H](C[C@H]3OC)O[C@@H]4[C@H](O[C@H](C[C@@H]4OC)O[C@H]5CC[C@@]6([C@H]7C[C@H]([C@@]8([C@@H](CC[C@@]8([C@@]7(CC=C6C5)O)O)C(=O)C)C)OC(=O)/C=C/C9=CC=CC=C9)C)C)C)C)OC)O |
InChI | InChI=1S/C58H86O18/c1-31(59)39-21-24-58(63)56(39,7)45(73-46(60)18-17-36-15-13-12-14-16-36)30-44-55(6)22-20-38(25-37(55)19-23-57(44,58)62)72-47-27-41(65-9)52(33(3)69-47)75-49-29-43(67-11)54(35(5)71-49)76-50-28-42(66-10)53(34(4)70-50)74-48-26-40(64-8)51(61)32(2)68-48/h12-19,32-35,38-45,47-54,61-63H,20-30H2,1-11H3/b18-17+/t32-,33-,34-,35-,38+,39+,40-,41+,42+,43-,44-,45-,47+,48+,49+,50+,51-,52-,53-,54-,55+,56+,57+,58-/m1/s1 |
InChI Key | CZSZZIVBRWCEHJ-IHNCFJEOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C58H86O18 |
Molecular Weight | 1071.30 g/mol |
Exact Mass | 1070.58141589 g/mol |
Topological Polar Surface Area (TPSA) | 215.00 Ų |
XlogP | 4.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.75% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.47% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.28% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.87% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.93% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.04% | 96.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 91.91% | 94.08% |
CHEMBL2581 | P07339 | Cathepsin D | 91.75% | 98.95% |
CHEMBL5028 | O14672 | ADAM10 | 91.63% | 97.50% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.07% | 94.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.08% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.37% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.32% | 91.07% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.18% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.86% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.25% | 99.23% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.27% | 100.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 83.04% | 83.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.88% | 95.93% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.76% | 97.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.63% | 97.14% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.03% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asclepias syriaca |
PubChem | 25209270 |
LOTUS | LTS0208079 |
wikiData | Q104973131 |