[(3aS,4R,5Z,8S,9Z,11R,11aR)-8,11-dihydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-4-yl] (2R)-2-methylbutanoate
| Internal ID | 3a24ced9-2258-4f04-a139-e61fce070f5c |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Germacranolides and derivatives |
| IUPAC Name | [(3aS,4R,5Z,8S,9Z,11R,11aR)-8,11-dihydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-4-yl] (2R)-2-methylbutanoate |
| SMILES (Canonical) | CCC(C)C(=O)OC1C=C(CC(C=C(C(C2C1C(=C)C(=O)O2)O)C)O)C |
| SMILES (Isomeric) | CC[C@@H](C)C(=O)O[C@@H]1/C=C(\C[C@@H](/C=C(\[C@H]([C@H]2[C@H]1C(=C)C(=O)O2)O)/C)O)/C |
| InChI | InChI=1S/C20H28O6/c1-6-11(3)19(23)25-15-8-10(2)7-14(21)9-12(4)17(22)18-16(15)13(5)20(24)26-18/h8-9,11,14-18,21-22H,5-7H2,1-4H3/b10-8-,12-9-/t11-,14+,15-,16+,17-,18-/m1/s1 |
| InChI Key | YFXZVQIPUJONOJ-YPGUEBOASA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.18858861 g/mol |
| Topological Polar Surface Area (TPSA) | 93.10 Ų |
| XlogP | 1.60 |
| Atomic LogP (AlogP) | 2.06 |
| H-Bond Acceptor | 6 |
| H-Bond Donor | 2 |
| Rotatable Bonds | 3 |
| There are no found synonyms. |
![2D Structure of [(3aS,4R,5Z,8S,9Z,11R,11aR)-8,11-dihydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-4-yl] (2R)-2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/0c26faa0-86d6-11ee-bc59-7323b6047cb1.jpg "2D Structure of [(3aS,4R,5Z,8S,9Z,11R,11aR)-8,11-dihydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-4-yl] (2R)-2-methylbutanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9802 | 98.02% |
| Caco-2 | + | 0.5084 | 50.84% |
| Blood Brain Barrier | + | 0.5750 | 57.50% |
| Human oral bioavailability | - | 0.6000 | 60.00% |
| Subcellular localzation | Mitochondria | 0.4747 | 47.47% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8526 | 85.26% |
| OATP1B3 inhibitior | + | 0.9072 | 90.72% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | - | 0.5946 | 59.46% |
| P-glycoprotein inhibitior | - | 0.6538 | 65.38% |
| P-glycoprotein substrate | - | 0.6865 | 68.65% |
| CYP3A4 substrate | + | 0.5947 | 59.47% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8823 | 88.23% |
| CYP3A4 inhibition | - | 0.6046 | 60.46% |
| CYP2C9 inhibition | - | 0.8304 | 83.04% |
| CYP2C19 inhibition | - | 0.7484 | 74.84% |
| CYP2D6 inhibition | - | 0.9435 | 94.35% |
| CYP1A2 inhibition | - | 0.7790 | 77.90% |
| CYP2C8 inhibition | - | 0.7352 | 73.52% |
| CYP inhibitory promiscuity | - | 0.8695 | 86.95% |
| UGT catelyzed | - | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9600 | 96.00% |
| Carcinogenicity (trinary) | Non-required | 0.4693 | 46.93% |
| Eye corrosion | - | 0.9704 | 97.04% |
| Eye irritation | - | 0.8993 | 89.93% |
| Skin irritation | - | 0.6171 | 61.71% |
| Skin corrosion | - | 0.9262 | 92.62% |
| Ames mutagenesis | - | 0.7200 | 72.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5475 | 54.75% |
| Micronuclear | - | 0.5700 | 57.00% |
| Hepatotoxicity | + | 0.6486 | 64.86% |
| skin sensitisation | - | 0.7004 | 70.04% |
| Respiratory toxicity | + | 0.6778 | 67.78% |
| Reproductive toxicity | + | 0.6667 | 66.67% |
| Mitochondrial toxicity | + | 0.6875 | 68.75% |
| Nephrotoxicity | - | 0.6700 | 67.00% |
| Acute Oral Toxicity (c) | III | 0.4381 | 43.81% |
| Estrogen receptor binding | + | 0.6622 | 66.22% |
| Androgen receptor binding | - | 0.5300 | 53.00% |
| Thyroid receptor binding | - | 0.5326 | 53.26% |
| Glucocorticoid receptor binding | + | 0.6109 | 61.09% |
| Aromatase binding | - | 0.5963 | 59.63% |
| PPAR gamma | - | 0.5246 | 52.46% |
| Honey bee toxicity | - | 0.7748 | 77.48% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.6950 | 69.50% |
| Fish aquatic toxicity | + | 0.9440 | 94.40% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.21% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.15% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.75% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.98% | 94.45% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.33% | 97.79% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.76% | 90.17% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.46% | 93.65% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.78% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.71% | 86.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.58% | 96.47% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.33% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.22% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.74% | 99.23% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.51% | 93.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.51% | 95.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.18% | 97.21% |
| PubChem | 162908012 |
| LOTUS | LTS0262855 |
| wikiData | Q105347901 |