[(1R,2R,3R,5R,6S,8S,9R,10S,11R,12S)-9,10-diacetyloxy-12-hydroxy-2,5,6,12-tetramethyl-7,16-dioxapentacyclo[9.7.0.02,8.06,8.013,17]octadeca-13(17),14-dien-3-yl] acetate
| Internal ID | d05c22c3-14ce-4721-9470-467f1d5b5104 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | [(1R,2R,3R,5R,6S,8S,9R,10S,11R,12S)-9,10-diacetyloxy-12-hydroxy-2,5,6,12-tetramethyl-7,16-dioxapentacyclo[9.7.0.02,8.06,8.013,17]octadeca-13(17),14-dien-3-yl] acetate |
| SMILES (Canonical) | CC1CC(C2(C3CC4=C(C=CO4)C(C3C(C(C25C1(O5)C)OC(=O)C)OC(=O)C)(C)O)C)OC(=O)C |
| SMILES (Isomeric) | C[C@@H]1C[C@H]([C@]2([C@@H]3CC4=C(C=CO4)[C@@]([C@H]3[C@@H]([C@H]([C@]25[C@]1(O5)C)OC(=O)C)OC(=O)C)(C)O)C)OC(=O)C |
| InChI | InChI=1S/C26H34O9/c1-12-10-19(32-13(2)27)23(5)17-11-18-16(8-9-31-18)24(6,30)20(17)21(33-14(3)28)22(34-15(4)29)26(23)25(12,7)35-26/h8-9,12,17,19-22,30H,10-11H2,1-7H3/t12-,17-,19-,20-,21+,22-,23-,24-,25+,26-/m1/s1 |
| InChI Key | XFBKUWVLEJBLBR-OSVGGLCZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H34O9 |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.22028266 g/mol |
| Topological Polar Surface Area (TPSA) | 125.00 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.68% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.64% | 91.11% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 92.98% | 97.79% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.92% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.37% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.87% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.66% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.48% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.43% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.97% | 85.14% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.73% | 92.94% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.27% | 100.00% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.24% | 94.80% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.11% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.95% | 93.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.95% | 90.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.76% | 97.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.47% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.25% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.12% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162922061 |
| LOTUS | LTS0135104 |
| wikiData | Q105132373 |