(1S,5R,7R,9S,11R)-11-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,4,8,8-tetramethyl-9-(2-methylpropanoyl)tetracyclo[7.3.1.17,11.01,5]tetradecane-10,12,13-trione
| Internal ID | 771ae745-c526-4a2e-b700-7dded793ea5f |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids |
| IUPAC Name | (1S,5R,7R,9S,11R)-11-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,4,8,8-tetramethyl-9-(2-methylpropanoyl)tetracyclo[7.3.1.17,11.01,5]tetradecane-10,12,13-trione |
| SMILES (Canonical) | CC(C)C(=O)C12C(=O)C34CCC(C3CC(C1(C)C)CC(C4=O)(C2=O)CC=C(C)CCC=C(C)C)(C)C |
| SMILES (Isomeric) | CC(C)C(=O)[C@@]12C(=O)[C@@]34CCC([C@H]3C[C@@H](C1(C)C)C[C@](C4=O)(C2=O)C/C=C(\C)/CCC=C(C)C)(C)C |
| InChI | InChI=1S/C32H46O4/c1-19(2)11-10-12-21(5)13-14-30-18-22-17-23-28(6,7)15-16-31(23,25(30)34)27(36)32(26(30)35,29(22,8)9)24(33)20(3)4/h11,13,20,22-23H,10,12,14-18H2,1-9H3/b21-13+/t22-,23-,30-,31+,32-/m1/s1 |
| InChI Key | XDMXMPLDQPLYCQ-FHPQNJFKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H46O4 |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.33960994 g/mol |
| Topological Polar Surface Area (TPSA) | 68.30 Ų |
| XlogP | 8.20 |
| There are no found synonyms. |
![2D Structure of (1S,5R,7R,9S,11R)-11-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,4,8,8-tetramethyl-9-(2-methylpropanoyl)tetracyclo[7.3.1.17,11.01,5]tetradecane-10,12,13-trione](https://plantaedb.com/storage/docs/compounds/2023/11/0c02fc70-84a3-11ee-b6da-f5dba2831865.jpg "2D Structure of (1S,5R,7R,9S,11R)-11-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,4,8,8-tetramethyl-9-(2-methylpropanoyl)tetracyclo[7.3.1.17,11.01,5]tetradecane-10,12,13-trione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.09% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.63% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.33% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.75% | 94.45% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.91% | 82.69% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.86% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.18% | 94.75% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.51% | 100.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.11% | 90.08% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 85.98% | 94.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.56% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.30% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.10% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.34% | 95.56% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.81% | 91.24% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.38% | 100.00% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.75% | 97.50% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.75% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.27% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hypericum sampsonii |
| PubChem | 163034508 |
| LOTUS | LTS0219845 |
| wikiData | Q105325916 |