[(1R,2S,3S,4S,6R,7S,10S,11R,16R,17R)-2,16,17-trihydroxy-7,11-dimethyl-6-[(1R)-1-[(2R)-5-methyl-6-oxo-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-2,3-dihydropyran-2-yl]ethyl]-12-oxo-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-13-en-3-yl] acetate
Internal ID | f1c5042b-2fb2-4a7f-b10b-3785c2a7a8f2 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
IUPAC Name | [(1R,2S,3S,4S,6R,7S,10S,11R,16R,17R)-2,16,17-trihydroxy-7,11-dimethyl-6-[(1R)-1-[(2R)-5-methyl-6-oxo-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-2,3-dihydropyran-2-yl]ethyl]-12-oxo-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-13-en-3-yl] acetate |
SMILES (Canonical) | CC1=C(CC(OC1=O)C(C)C23C(O2)C(C4(C3(CCC5C4CC(C6(C5(C(=O)C=CC6)C)O)O)C)O)OC(=O)C)COC7C(C(C(C(O7)CO)O)O)O |
SMILES (Isomeric) | CC1=C(C[C@@H](OC1=O)[C@@H](C)[C@@]23[C@@H](O2)[C@@H]([C@]4([C@@]3(CC[C@H]5[C@H]4C[C@H]([C@@]6([C@@]5(C(=O)C=CC6)C)O)O)C)O)OC(=O)C)CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O |
InChI | InChI=1S/C36H50O15/c1-15-18(14-47-31-27(43)26(42)25(41)22(13-37)50-31)11-21(49-30(15)44)16(2)36-29(51-36)28(48-17(3)38)35(46)20-12-24(40)34(45)9-6-7-23(39)33(34,5)19(20)8-10-32(35,36)4/h6-7,16,19-22,24-29,31,37,40-43,45-46H,8-14H2,1-5H3/t16-,19+,20-,21-,22-,24-,25-,26+,27-,28+,29+,31-,32+,33+,34+,35-,36+/m1/s1 |
InChI Key | LBNOIKRBLYMNFW-XPQZGYLJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H50O15 |
Molecular Weight | 722.80 g/mol |
Exact Mass | 722.31497088 g/mol |
Topological Polar Surface Area (TPSA) | 242.00 Ų |
XlogP | -1.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.65% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.12% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.62% | 91.11% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 94.68% | 97.79% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.46% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.71% | 97.25% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.46% | 97.14% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.38% | 96.61% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 91.21% | 91.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.19% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.50% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.41% | 95.56% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.59% | 96.47% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.47% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.85% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.79% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.67% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.06% | 89.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.02% | 95.93% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.47% | 93.56% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.53% | 91.07% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.41% | 95.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.95% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.03% | 98.95% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.14% | 97.36% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.13% | 93.04% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.34% | 91.19% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.67% | 90.08% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.53% | 98.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.22% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Physalis angulata |
PubChem | 10101401 |
LOTUS | LTS0112893 |
wikiData | Q105149487 |