methyl (1S,4aS,7S,7aS)-7-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]-1-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
Internal ID | 4db485e8-777a-43c9-937d-756deeed4d59 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl (1S,4aS,7S,7aS)-7-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]-1-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | COC(=O)C1=COC(C2C1CCC2COC(=O)C=CC3=CC=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC(=O)C1=CO[C@H]([C@H]2[C@@H]1CC[C@@H]2COC(=O)/C=C/C3=CC=C(C=C3)O)O[C@H]4[C@H]([C@H]([C@@H]([C@@H](O4)CO)O)O)O |
InChI | InChI=1S/C26H32O12/c1-34-24(33)17-12-36-25(38-26-23(32)22(31)21(30)18(10-27)37-26)20-14(5-8-16(17)20)11-35-19(29)9-4-13-2-6-15(28)7-3-13/h2-4,6-7,9,12,14,16,18,20-23,25-28,30-32H,5,8,10-11H2,1H3/b9-4+/t14-,16-,18+,20-,21-,22+,23+,25+,26+/m1/s1 |
InChI Key | COQOXCPEJJIULA-ZTJYZXNQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H32O12 |
Molecular Weight | 536.50 g/mol |
Exact Mass | 536.18937645 g/mol |
Topological Polar Surface Area (TPSA) | 181.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
![2D Structure of methyl (1S,4aS,7S,7aS)-7-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]-1-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate 2D Structure of methyl (1S,4aS,7S,7aS)-7-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]-1-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/0bd6fd10-8552-11ee-b392-c7792b7a15bd.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.97% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.60% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.36% | 97.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.78% | 83.82% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.39% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.19% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.40% | 89.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 91.25% | 89.67% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.45% | 95.93% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.41% | 99.17% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 88.01% | 95.83% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.68% | 92.50% |
CHEMBL2581 | P07339 | Cathepsin D | 87.36% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.31% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.27% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.61% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.39% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.00% | 90.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.40% | 89.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.96% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Viburnum luzonicum |
PubChem | 163189674 |
LOTUS | LTS0165523 |
wikiData | Q104967232 |