[(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-8,14,17-trihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,4S,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] pyridine-3-carboxylate
Internal ID | 5d1b95d7-d387-408d-8e5d-791a5e4318ef |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-8,14,17-trihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,4S,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] pyridine-3-carboxylate |
SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4OC)OC5CCC6(C7CC(C8(C(CCC8(C7(CC=C6C5)O)O)(C(=O)C)O)C)OC(=O)C9=CN=CC=C9)C)C)C)C)OC)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H](C[C@@H](O1)O[C@@H]2[C@H](O[C@H](C[C@H]2OC)O[C@@H]3[C@H](O[C@H](C[C@@H]3OC)O[C@@H]4[C@H](O[C@H](C[C@@H]4OC)O[C@H]5CC[C@@]6([C@H]7C[C@H]([C@@]8([C@@](CC[C@@]8([C@@]7(CC=C6C5)O)O)(C(=O)C)O)C)OC(=O)C9=CN=CC=C9)C)C)C)C)OC)O |
InChI | InChI=1S/C55H83NO19/c1-28-46(58)36(63-8)22-43(67-28)73-48-30(3)69-45(24-38(48)65-10)75-49-31(4)70-44(25-39(49)66-11)74-47-29(2)68-42(23-37(47)64-9)71-35-15-16-51(6)34(21-35)14-17-54(61)40(51)26-41(72-50(59)33-13-12-20-56-27-33)52(7)53(60,32(5)57)18-19-55(52,54)62/h12-14,20,27-31,35-49,58,60-62H,15-19,21-26H2,1-11H3/t28-,29+,30+,31+,35-,36-,37-,38+,39-,40+,41+,42-,43-,44-,45-,46-,47+,48+,49+,51-,52+,53+,54-,55+/m0/s1 |
InChI Key | ZANZUZKNPKKTQM-CPYDGAJJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C55H83NO19 |
Molecular Weight | 1062.20 g/mol |
Exact Mass | 1061.55592942 g/mol |
Topological Polar Surface Area (TPSA) | 248.00 Ų |
XlogP | 2.50 |
There are no found synonyms. |
![2D Structure of [(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-8,14,17-trihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,4S,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] pyridine-3-carboxylate 2D Structure of [(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-8,14,17-trihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,4S,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] pyridine-3-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/0bc9e620-858e-11ee-b4b6-cdc58f710cb7.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.97% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.08% | 86.33% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 94.52% | 91.07% |
CHEMBL2581 | P07339 | Cathepsin D | 92.59% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.11% | 99.23% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 92.01% | 97.53% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.89% | 100.00% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 91.28% | 98.59% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.13% | 85.14% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.63% | 83.82% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.47% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.80% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.58% | 95.89% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 89.21% | 97.33% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.23% | 95.93% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 87.42% | 100.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.16% | 91.11% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 84.86% | 96.39% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.53% | 92.94% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.47% | 97.79% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 84.40% | 83.00% |
CHEMBL5028 | O14672 | ADAM10 | 83.42% | 97.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.80% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.37% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.68% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Orthosia guilleminiana |
PubChem | 162853172 |
LOTUS | LTS0082420 |
wikiData | Q105369964 |