9-[[(2S,3R)-2-(hydroxymethyl)-6-methoxy-2,3-dihydro-1-benzofuran-3-yl]oxy]-3,10-dimethoxybenzo[c]chromen-6-one
| Internal ID | 4047a9db-0362-4514-9504-27f68dbf53e0 |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
| IUPAC Name | 9-[[(2S,3R)-2-(hydroxymethyl)-6-methoxy-2,3-dihydro-1-benzofuran-3-yl]oxy]-3,10-dimethoxybenzo[c]chromen-6-one |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C(C(O2)CO)OC3=C(C4=C(C=C3)C(=O)OC5=C4C=CC(=C5)OC)OC |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)[C@H]([C@@H](O2)CO)OC3=C(C4=C(C=C3)C(=O)OC5=C4C=CC(=C5)OC)OC |
| InChI | InChI=1S/C25H22O8/c1-28-13-4-6-15-19(10-13)33-25(27)17-8-9-18(24(30-3)22(15)17)32-23-16-7-5-14(29-2)11-20(16)31-21(23)12-26/h4-11,21,23,26H,12H2,1-3H3/t21-,23+/m0/s1 |
| InChI Key | XQGIMXOQGCIMSM-JTHBVZDNSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H22O8 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.13146766 g/mol |
| Topological Polar Surface Area (TPSA) | 92.70 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.77% | 91.11% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 96.01% | 86.92% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.74% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.18% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.43% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.35% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.07% | 95.56% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.85% | 93.31% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.84% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.83% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.83% | 86.33% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.47% | 92.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.87% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.89% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.51% | 94.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.12% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Umtiza listeriana |
| PubChem | 163189477 |
| LOTUS | LTS0110985 |
| wikiData | Q105339675 |