(E)-4-[[(1R,2S,8R,9S,10S,12R,13R,14S,17S,19R,20S,21R,23E)-9,21-dihydroxy-23-(1-methoxy-1-oxopropan-2-ylidene)-5,13,20-trimethyl-4,22-dioxo-3-oxaoctacyclo[14.7.1.02,6.02,14.08,13.010,12.017,19.020,24]tetracosa-5,16(24)-dien-9-yl]methoxy]-3-methyl-4-oxobut-2-enoic acid
Internal ID | 0d3bfce5-d582-4483-870a-abd1a6d21d4d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (E)-4-[[(1R,2S,8R,9S,10S,12R,13R,14S,17S,19R,20S,21R,23E)-9,21-dihydroxy-23-(1-methoxy-1-oxopropan-2-ylidene)-5,13,20-trimethyl-4,22-dioxo-3-oxaoctacyclo[14.7.1.02,6.02,14.08,13.010,12.017,19.020,24]tetracosa-5,16(24)-dien-9-yl]methoxy]-3-methyl-4-oxobut-2-enoic acid |
SMILES (Canonical) | CC1=C2CC3C(C4CC4C3(COC(=O)C(=CC(=O)O)C)O)(C5C2(C6C7=C(C5)C8CC8C7(C(C(=O)C6=C(C)C(=O)OC)O)C)OC1=O)C |
SMILES (Isomeric) | CC1=C2C[C@@H]3[C@@]([C@@H]4C[C@@H]4[C@]3(COC(=O)/C(=C/C(=O)O)/C)O)([C@H]5[C@@]2([C@@H]\6C7=C(C5)[C@H]8C[C@H]8[C@@]7([C@H](C(=O)/C6=C(\C)/C(=O)OC)O)C)OC1=O)C |
InChI | InChI=1S/C36H40O11/c1-13(7-24(37)38)30(41)46-12-35(44)21-10-20(21)33(4)22(35)11-18-14(2)32(43)47-36(18)23(33)9-17-16-8-19(16)34(5)26(17)27(36)25(28(39)29(34)40)15(3)31(42)45-6/h7,16,19-23,27,29,40,44H,8-12H2,1-6H3,(H,37,38)/b13-7+,25-15+/t16-,19-,20-,21+,22-,23+,27+,29+,33-,34+,35+,36+/m1/s1 |
InChI Key | SJKPVCKDMMDYGC-MVLFZFNLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H40O11 |
Molecular Weight | 648.70 g/mol |
Exact Mass | 648.25706209 g/mol |
Topological Polar Surface Area (TPSA) | 174.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.52% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.45% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.55% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.55% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.72% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.47% | 94.45% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.62% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.49% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.73% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.11% | 97.14% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.33% | 95.93% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.14% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.91% | 97.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.55% | 97.79% |
CHEMBL5028 | O14672 | ADAM10 | 85.28% | 97.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.10% | 99.17% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 83.86% | 95.58% |
CHEMBL299 | P17252 | Protein kinase C alpha | 83.58% | 98.03% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.54% | 93.03% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.44% | 91.07% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.42% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chloranthus fortunei |
PubChem | 163068503 |
LOTUS | LTS0062930 |
wikiData | Q105254367 |