[(1S,3S,4R,4aR,7R,8R,8aS)-3,7-dihydroxy-8-methoxy-3,4,8,8a-tetramethyl-4-[(E)-2-(5-oxo-2H-furan-3-yl)ethenyl]-1,2,4a,5,6,7-hexahydronaphthalen-1-yl] benzoate
| Internal ID | d72cb188-e034-41a3-8135-e4cb8c8d4c29 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
| IUPAC Name | [(1S,3S,4R,4aR,7R,8R,8aS)-3,7-dihydroxy-8-methoxy-3,4,8,8a-tetramethyl-4-[(E)-2-(5-oxo-2H-furan-3-yl)ethenyl]-1,2,4a,5,6,7-hexahydronaphthalen-1-yl] benzoate |
| SMILES (Canonical) | CC1(CC(C2(C(C1(C)C=CC3=CC(=O)OC3)CCC(C2(C)OC)O)C)OC(=O)C4=CC=CC=C4)O |
| SMILES (Isomeric) | C[C@@]1(C[C@@H]([C@@]2([C@@H]([C@@]1(C)/C=C/C3=CC(=O)OC3)CC[C@H]([C@]2(C)OC)O)C)OC(=O)C4=CC=CC=C4)O |
| InChI | InChI=1S/C28H36O7/c1-25(14-13-18-15-23(30)34-17-18)20-11-12-21(29)28(4,33-5)27(20,3)22(16-26(25,2)32)35-24(31)19-9-7-6-8-10-19/h6-10,13-15,20-22,29,32H,11-12,16-17H2,1-5H3/b14-13+/t20-,21-,22+,25-,26+,27+,28+/m1/s1 |
| InChI Key | DHQHOSQECUANRT-AGBWETBISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H36O7 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24610348 g/mol |
| Topological Polar Surface Area (TPSA) | 102.00 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
![2D Structure of [(1S,3S,4R,4aR,7R,8R,8aS)-3,7-dihydroxy-8-methoxy-3,4,8,8a-tetramethyl-4-[(E)-2-(5-oxo-2H-furan-3-yl)ethenyl]-1,2,4a,5,6,7-hexahydronaphthalen-1-yl] benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/0a51b4f0-8727-11ee-9089-e9f0bce8305d.jpg "2D Structure of [(1S,3S,4R,4aR,7R,8R,8aS)-3,7-dihydroxy-8-methoxy-3,4,8,8a-tetramethyl-4-[(E)-2-(5-oxo-2H-furan-3-yl)ethenyl]-1,2,4a,5,6,7-hexahydronaphthalen-1-yl] benzoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL240 | Q12809 | HERG | 98.30% | 89.76% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.21% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.18% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.14% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.99% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.91% | 91.49% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.36% | 95.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.25% | 99.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.59% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.39% | 96.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.87% | 98.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.59% | 90.17% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.31% | 92.97% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.28% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.89% | 89.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.64% | 99.17% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.04% | 94.62% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 82.57% | 83.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.56% | 97.14% |
| CHEMBL5028 | O14672 | ADAM10 | 82.22% | 97.50% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 81.17% | 96.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.22% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14336516 |
| LOTUS | LTS0082814 |
| wikiData | Q104980750 |