[(1R)-1-[(2R,3S,4R,5R)-3-hydroxy-4-[(2S,3R,4S,5S,6R)-4-hydroxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-5-[(3S,6R)-2-methyl-6-[(3S,5S,6R,7R,8S,9R,10S,13R,14S,15R,17R)-3,6,7,8,15-pentahydroxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]heptan-3-yl]oxyoxolan-2-yl]ethyl] hydrogen sulfate
| Internal ID | 32ae8682-9213-49ab-a1e8-84e64189a4f5 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
| IUPAC Name | [(1R)-1-[(2R,3S,4R,5R)-3-hydroxy-4-[(2S,3R,4S,5S,6R)-4-hydroxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-5-[(3S,6R)-2-methyl-6-[(3S,5S,6R,7R,8S,9R,10S,13R,14S,15R,17R)-3,6,7,8,15-pentahydroxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]heptan-3-yl]oxyoxolan-2-yl]ethyl] hydrogen sulfate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC2OC(CCC(C)C3CC(C4C3(CCC5C4(C(C(C6C5(CCC(C6)O)C)O)O)O)C)O)C(C)C)C(C)OS(=O)(=O)O)O)OC)O)OC |
| SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](O[C@H]2O[C@@H](CC[C@@H](C)[C@H]3C[C@H]([C@@H]4[C@@]3(CC[C@H]5[C@]4([C@@H]([C@@H]([C@@H]6[C@@]5(CC[C@@H](C6)O)C)O)O)O)C)O)C(C)C)[C@@H](C)OS(=O)(=O)O)O)OC)O)OC |
| InChI | InChI=1S/C41H72O17S/c1-18(2)26(55-38-34(30(46)32(56-38)21(5)58-59(49,50)51)57-37-33(53-9)29(45)31(52-8)20(4)54-37)11-10-19(3)23-17-25(43)35-40(23,7)15-13-27-39(6)14-12-22(42)16-24(39)28(44)36(47)41(27,35)48/h18-38,42-48H,10-17H2,1-9H3,(H,49,50,51)/t19-,20-,21-,22+,23-,24-,25-,26+,27-,28-,29+,30+,31-,32+,33-,34-,35-,36-,37+,38-,39+,40-,41+/m1/s1 |
| InChI Key | NNLPOXIHDIBDQW-XBTBRXQUSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C41H72O17S |
| Molecular Weight | 869.10 g/mol |
| Exact Mass | 868.44902200 g/mol |
| Topological Polar Surface Area (TPSA) | 269.00 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 97.17% | 85.31% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.10% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.86% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.62% | 97.25% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 94.60% | 95.89% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 93.86% | 95.93% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.11% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.60% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.32% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.14% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.05% | 89.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.27% | 100.00% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 88.15% | 95.58% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 87.85% | 92.78% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.47% | 97.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.78% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.96% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.94% | 95.89% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 85.47% | 97.31% |
| CHEMBL1871 | P10275 | Androgen Receptor | 85.43% | 96.43% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.61% | 96.90% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.75% | 93.56% |
| CHEMBL5028 | O14672 | ADAM10 | 83.54% | 97.50% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.47% | 95.50% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 82.53% | 95.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.15% | 98.05% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.84% | 94.73% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.24% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14680239 |
| LOTUS | LTS0187835 |
| wikiData | Q105182202 |