10-[5-[4,5-Dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-4a-(hydroxymethyl)-2,6a,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carbaldehyde
Internal ID | bc7b0e76-c9f3-49c0-8c52-89a0660b8ac6 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 10-[5-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-4a-(hydroxymethyl)-2,6a,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carbaldehyde |
SMILES (Canonical) | CC1(C2CCC3(C(C2(CCC1OC4C(C(C(CO4)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(CO6)O)O)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)CC=C8C3(CC(C9(C8CC(CC9)(C)C=O)CO)O)C)C)C |
SMILES (Isomeric) | CC1(C2CCC3(C(C2(CCC1OC4C(C(C(CO4)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(CO6)O)O)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)CC=C8C3(CC(C9(C8CC(CC9)(C)C=O)CO)O)C)C)C |
InChI | InChI=1S/C52H84O22/c1-47(2)29-9-12-50(5)30(8-7-23-24-15-48(3,21-55)13-14-52(24,22-56)31(58)16-51(23,50)6)49(29,4)11-10-32(47)72-45-41(74-44-40(66)37(63)34(60)26(17-53)69-44)36(62)28(20-68-45)71-46-42(38(64)35(61)27(18-54)70-46)73-43-39(65)33(59)25(57)19-67-43/h7,21,24-46,53-54,56-66H,8-20,22H2,1-6H3 |
InChI Key | FWUBJULUZZNJHQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C52H84O22 |
Molecular Weight | 1061.20 g/mol |
Exact Mass | 1060.54542430 g/mol |
Topological Polar Surface Area (TPSA) | 354.00 Ų |
XlogP | -1.00 |
There are no found synonyms. |
![2D Structure of 10-[5-[4,5-Dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-4a-(hydroxymethyl)-2,6a,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carbaldehyde 2D Structure of 10-[5-[4,5-Dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-4a-(hydroxymethyl)-2,6a,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/0a447900-86f9-11ee-bc4f-357b7b16b0ad.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.04% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.03% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.09% | 94.45% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.42% | 90.17% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.32% | 96.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.01% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.51% | 95.56% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.14% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.95% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.41% | 97.09% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.15% | 97.28% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.88% | 86.92% |
CHEMBL2581 | P07339 | Cathepsin D | 83.75% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.66% | 94.00% |
CHEMBL5028 | O14672 | ADAM10 | 82.45% | 97.50% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.31% | 96.77% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.53% | 94.75% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.71% | 96.61% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.66% | 95.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.50% | 94.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.42% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Myrsine pellucida |
PubChem | 162885098 |
LOTUS | LTS0116857 |
wikiData | Q105003578 |