(3Z)-8a-hydroxy-8,8-dimethyl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-5,6,7,8b-tetrahydro-3aH-indeno[1,2-b]furan-2-one
Internal ID | fe52e9b1-ca1f-436d-8cd4-a1618b8db976 |
Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
IUPAC Name | (3Z)-8a-hydroxy-8,8-dimethyl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-5,6,7,8b-tetrahydro-3aH-indeno[1,2-b]furan-2-one |
SMILES (Canonical) | CC1=CC(OC1=O)OC=C2C3C=C4CCCC(C4(C3OC2=O)O)(C)C |
SMILES (Isomeric) | CC1=CC(OC1=O)O/C=C\2/C3C=C4CCCC(C4(C3OC2=O)O)(C)C |
InChI | InChI=1S/C19H22O6/c1-10-7-14(24-16(10)20)23-9-13-12-8-11-5-4-6-18(2,3)19(11,22)15(12)25-17(13)21/h7-9,12,14-15,22H,4-6H2,1-3H3/b13-9- |
InChI Key | FIKOOQXJBAJJSE-LCYFTJDESA-N |
Popularity | 2 references in papers |
Molecular Formula | C19H22O6 |
Molecular Weight | 346.40 g/mol |
Exact Mass | 346.14163842 g/mol |
Topological Polar Surface Area (TPSA) | 82.10 Ų |
XlogP | 2.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.19% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.48% | 97.25% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.37% | 94.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.54% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.32% | 96.09% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.10% | 89.63% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 89.40% | 91.07% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.22% | 93.99% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.17% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.81% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.66% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.11% | 95.89% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.36% | 93.40% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 85.09% | 95.69% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.60% | 94.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.79% | 93.04% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.65% | 90.08% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.44% | 89.00% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 80.24% | 92.51% |
CHEMBL5028 | O14672 | ADAM10 | 80.16% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Trifolium pratense |
PubChem | 131753126 |
LOTUS | LTS0073732 |
wikiData | Q104995749 |