[(1S,2R,4S,7R,8S,12R,19R)-7-(2-hydroxy-5-oxo-2H-furan-4-yl)-1,8,12,16,16-pentamethyl-5,15-dioxo-3,6-dioxapentacyclo[9.8.0.02,4.02,8.012,17]nonadec-13-en-19-yl] acetate
Internal ID | f39eeecb-3b60-4b98-a920-a15495cc503c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [(1S,2R,4S,7R,8S,12R,19R)-7-(2-hydroxy-5-oxo-2H-furan-4-yl)-1,8,12,16,16-pentamethyl-5,15-dioxo-3,6-dioxapentacyclo[9.8.0.02,4.02,8.012,17]nonadec-13-en-19-yl] acetate |
SMILES (Canonical) | CC(=O)OC1CC2C(C(=O)C=CC2(C3C1(C45C(O4)C(=O)OC(C5(CC3)C)C6=CC(OC6=O)O)C)C)(C)C |
SMILES (Isomeric) | CC(=O)O[C@@H]1CC2[C@](C=CC(=O)C2(C)C)(C3[C@@]1([C@]45[C@H](O4)C(=O)O[C@H]([C@@]5(CC3)C)C6=CC(OC6=O)O)C)C |
InChI | InChI=1S/C28H34O9/c1-13(29)34-18-12-16-24(2,3)17(30)8-9-25(16,4)15-7-10-26(5)20(14-11-19(31)35-22(14)32)36-23(33)21-28(26,37-21)27(15,18)6/h8-9,11,15-16,18-21,31H,7,10,12H2,1-6H3/t15?,16?,18-,19?,20+,21-,25-,26+,27+,28-/m1/s1 |
InChI Key | RNDCBBAMBNUYHC-CKDFSRAWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H34O9 |
Molecular Weight | 514.60 g/mol |
Exact Mass | 514.22028266 g/mol |
Topological Polar Surface Area (TPSA) | 129.00 Ų |
XlogP | 2.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.88% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.78% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.39% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.89% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 87.80% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.61% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.58% | 82.69% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.29% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.04% | 91.19% |
CHEMBL5028 | O14672 | ADAM10 | 83.41% | 97.50% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.21% | 97.28% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.12% | 93.04% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.92% | 91.07% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.83% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.69% | 89.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.66% | 97.79% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.36% | 92.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.25% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cedrela fissilis |
PubChem | 162911111 |
LOTUS | LTS0095040 |
wikiData | Q105241249 |