(1R,2R,4R,5S,9R)-2,11-dimethyl-6-methylidene-8-oxatetracyclo[8.3.0.02,4.05,9]tridec-10-ene-7,12-dione
| Internal ID | f6e47abf-5963-45ee-976f-6799b3b6551d |
| Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
| IUPAC Name | (1R,2R,4R,5S,9R)-2,11-dimethyl-6-methylidene-8-oxatetracyclo[8.3.0.02,4.05,9]tridec-10-ene-7,12-dione |
| SMILES (Canonical) | CC1=C2C(CC1=O)C3(CC3C4C2OC(=O)C4=C)C |
| SMILES (Isomeric) | CC1=C2[C@H](CC1=O)[C@@]3(C[C@@H]3[C@@H]4[C@H]2OC(=O)C4=C)C |
| InChI | InChI=1S/C15H16O3/c1-6-10(16)4-8-11(6)13-12(7(2)14(17)18-13)9-5-15(8,9)3/h8-9,12-13H,2,4-5H2,1,3H3/t8-,9+,12+,13-,15-/m0/s1 |
| InChI Key | KTTIHIGGDOOVBX-LLSOINDXSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.109944368 g/mol |
| Topological Polar Surface Area (TPSA) | 43.40 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
![2D Structure of (1R,2R,4R,5S,9R)-2,11-dimethyl-6-methylidene-8-oxatetracyclo[8.3.0.02,4.05,9]tridec-10-ene-7,12-dione](https://plantaedb.com/storage/docs/compounds/2023/11/091c5a00-8591-11ee-b03c-4f0ac6875b71.jpg "2D Structure of (1R,2R,4R,5S,9R)-2,11-dimethyl-6-methylidene-8-oxatetracyclo[8.3.0.02,4.05,9]tridec-10-ene-7,12-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.96% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.08% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.83% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.07% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.90% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.23% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.31% | 94.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.15% | 99.23% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.51% | 97.79% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.02% | 100.00% |
| CHEMBL3920 | Q04759 | Protein kinase C theta | 82.01% | 97.69% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 81.26% | 86.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.15% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Capitanopsis albida |
| Iva axillaris |
| PubChem | 163104789 |
| LOTUS | LTS0103248 |
| wikiData | Q104995920 |