2-[2-(3',6'-Dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl)oxy-4-hydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | a3d1cc93-6a65-46fa-8c70-b2e9b4dd6c04 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[2-(3',6'-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl)oxy-4-hydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CC(C2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(CO8)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)OC1O)O |
SMILES (Isomeric) | CC1CC(C2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(CO8)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)OC1O)O |
InChI | InChI=1S/C44H70O18/c1-17-12-28(47)44(62-38(17)54)18(2)29-26(61-44)14-24-22-7-6-20-13-21(8-10-42(20,4)23(22)9-11-43(24,29)5)57-41-37(60-40-34(52)32(50)30(48)19(3)56-40)35(53)36(27(15-45)58-41)59-39-33(51)31(49)25(46)16-55-39/h6,17-19,21-41,45-54H,7-16H2,1-5H3 |
InChI Key | YJEDERNKWZNDRS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H70O18 |
Molecular Weight | 887.00 g/mol |
Exact Mass | 886.45621538 g/mol |
Topological Polar Surface Area (TPSA) | 276.00 Ų |
XlogP | -0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.02% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.73% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.40% | 95.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.94% | 100.00% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 93.75% | 95.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.65% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.97% | 94.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.45% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.02% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.57% | 97.25% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.42% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.12% | 95.89% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.48% | 96.61% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.52% | 92.94% |
CHEMBL1871 | P10275 | Androgen Receptor | 84.43% | 96.43% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 83.95% | 95.92% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.94% | 97.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.58% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 83.56% | 98.95% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.19% | 97.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.67% | 94.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.58% | 89.05% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.38% | 97.36% |
CHEMBL5028 | O14672 | ADAM10 | 82.03% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum lasiocarpum |
PubChem | 163085567 |
LOTUS | LTS0116849 |
wikiData | Q105349205 |